Clazamycin A

Catalog Number	ACM71806558
CAS Number	71806-55-8
Synonyms	(2S,7aR)-2α-Chloro-2,3-dihydro-5-imino-1H-pyrrolizin-7aβ(5H)-ol
Molecular Weight	172.61
InChI	InChI=1S/C7H9ClN2O/c8-5-3-7(11)2-1-6(9)10(7)4-5/h1-2,5,9,11H,3-4H2/t5-,7-/m0/s1
InChI Key	DVCHIDKMDZZKBR-FSPLSTOPSA-N
Purity	95%+
Complexity	241
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	172.0403406
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C1[C@@H](CN2[C@@]1(C=CC2=N)O)Cl
Monoisotopic Mass	172.0403406
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	47.3 Ų

Custom Q&A

What is the chemical formula for clazamycin A?

The chemical formula for clazamycin A is C7H9ClN2O.

What is the molecular weight of clazamycin A?

The molecular weight of clazamycin A is 172.61.

What are the synonyms for clazamycin A?

The synonyms for clazamycin A are clazamycin A and (2S,7aR)-2α-Chloro-2,3-dihydro-5-imino-1H-pyrrolizin-7aβ(5H)-ol.

What is the CAS number for clazamycin A?

The CAS number for clazamycin A is 71806-55-8.

What is the structure of clazamycin A?

The structure of clazamycin A is (2S,7aR)-2α-Chloro-2,3-dihydro-5-imino-1H-pyrrolizin-7aβ(5H)-ol.

How many nitrogen atoms are present in the molecular formula of clazamycin A?

There are 2 nitrogen atoms present in the molecular formula of clazamycin A.

What type of compound is clazamycin A?

Clazamycin A is a pyrrolizin compound.

What is the IUPAC name for clazamycin A?

The IUPAC name for clazamycin A is 2-chloro-2,3-dihydro-5-imino-1H-pyrrolizin-7a(5H)-ol, (2S,7aR).

What is the specific rotation of clazamycin A?

The specific rotation of clazamycin A is (2S,7aR).

※ Please kindly note that our products are for research use only.