Clivorine

Catalog Number	ACM33979156
CAS Number	33979-15-6
Structure
Synonyms	(8ξ,12S,14Z)-12-Acetoxy-14,15,20,21-tetradehydro-15,20-dihydro-8-hydroxy-4-methyl-11,16-dioxosenecionan-4-ium
Molecular Weight	405.4
InChI	InChI=1S/C21H27NO7/c1-6-15-11-13(2)20(4,29-14(3)23)19(25)27-12-16-7-9-22(5)10-8-17(21(16,22)26)28-18(15)24/h6-7,11,13,17H,1,8-10,12H2,2-5H3/b15-11-/t13-,17+,20-,21,22/m0/s1
InChI Key	YEGVHSDONMXATH-LKVOMWJFSA-N
Melting Point	149 °C
Purity	95%+
Complexity	831
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	405.1787522
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@H]1/C=C(\C(=O)O[C@@H]2CC[N+]3(C2(C(=CC3)COC(=O)[C@@]1(C)OC(=O)C)[O-])C)/C=C
Monoisotopic Mass	405.1787522
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	102 Ų

Custom Q&A

What is the chemical formula for clivorine?

The chemical formula for clivorine is C21H27NO7.

What is the molecular weight of clivorine?

The molecular weight of clivorine is 405.444.

What is the melting point of clivorine?

The melting point of clivorine is 149°C.

What is the boiling point of clivorine?

The boiling point of clivorine is approximately 527.53°C.

What is the density of clivorine?

The density of clivorine is estimated to be 1.2863.

What is the refractive index of clivorine?

The refractive index of clivorine is estimated to be 1.5614.

What are some synonyms for clivorine?

Some synonyms for clivorine include Clivoline, clivorine, and Senecionanium, 12-(acetyloxy)-11,16-dioxo.

What is the CAS number for clivorine?

The CAS number for clivorine is 33979-15-6.

How many carbon atoms are present in the chemical structure of clivorine?

There are 21 carbon atoms present in the chemical structure of clivorine.

What is the molecular structure of clivorine?

The molecular structure of clivorine is (8ξ,12S,14Z)-12-Acetoxy-14,15,20,21-tetradehydro-15,20-dihydro-8-hydroxy-4-methyl-11,16-dioxosenecionan-4-ium.

※ Please kindly note that our products are for research use only.