Coixol

Coixol

Inquiry
Catalog Number ACM532912
CAS Number 532-91-2
Structure
Synonyms 6-Methoxy-2,3-dihydrobenzoxazole-2-one
IUPAC Name 6-Methoxy-3H-1,3-benzoxazol-2-one
Molecular Weight 165.15
Molecular Formula C8H7NO3
Canonical SMILES COC1=CC2=C(C=C1)NC(=O)O2
InChI InChI=1S/C8H7NO3/c1-11-5-2-3-6-7(4-5)12-8(10)9-6/h2-4H,1H3,(H,9,10)
InChI Key MKMCJLMBVKHUMS-UHFFFAOYSA-N
Boiling Point 292.97 °C
Melting Point 151-156 °C (lit.)
Purity 98%
Density 1.345 g/ml
Appearance Powder
Storage 2-8°C
Complexity 195
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 165.042593085
Heavy Atom Count 12
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 1
Monoisotopic Mass 165.042593085
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 47.6 Ų
Custom Q&A

What is the chemical name of the compound with the CAS number 532-91-2?

The chemical name is 6-Methoxy-2-benzoxazolinone.

What are some synonyms for 6-Methoxy-2-benzoxazolinone?

Some synonyms are JRH-04701, 6-Methoxybenzo[d]oxazol-2(3H)-one, 6-Methoxy-2,3-dihydrobenzoxazole-2-one, etc.

What is the molecular formula of 6-Methoxy-2-benzoxazolinone?

The molecular formula is C8H7NO3.

What is the melting point of 6-Methoxy-2-benzoxazolinone?

The melting point is 151-156 °C.

What is the density of 6-Methoxy-2-benzoxazolinone?

The density is 1.3450.

What are the safety statements associated with 6-Methoxy-2-benzoxazolinone?

The safety statements are 22-24/25.

What is the usage of 6-Methoxy-2-benzoxazolinone?

It is an intermediate in the synthesis of DIMBOA-4-O-β-D-glucuronide, which acts as an antifungal and antialgal agent in crops.

How is 6-Methoxy-2-benzoxazolinone synthesized?

It is obtained by reacting 2-amino-5-methoxyphenol hydrochloride with urea.

How is Coixol defined in terms of chemical structure?

Coixol is a benzoxazole.

In what publication can the synthesis of 6-Methoxy-2-benzoxazolinone be found?

The synthesis can be found in the Synthetic Communications journal, volume 23, page 343, 1993.

※ Please kindly note that our products are for research use only.