Consiculine

Catalog Number	ACM219829739
CAS Number	219829-73-9
Molecular Weight	363.4
InChI	InChI=1S/C20H29NO5/c1-12(2)4-5-13-11-20(25,18(23)10-17(13)22)19(24)26-16-8-14-6-7-15(9-16)21(14)3/h4,11,14-16,18,23,25H,5-10H2,1-3H3/t14,15,16,18-,20-/m1/s1
InChI Key	YNZLEIVXMIJPPH-JETMDNNTSA-N
Purity	95%+
Complexity	637
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	363.20457303
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(=CCC1=C[C@@]([C@@H](CC1=O)O)(C(=O)OC2CC3CCC(C2)N3C)O)C
Monoisotopic Mass	363.20457303
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	87.1 Ų

Custom Q&A

What is the chemical formula of Consiculine?

The chemical formula of Consiculine is C20H29NO5.

What is the molecular weight of Consiculine?

The molecular weight of Consiculine is 363.45.

What is the CAS number of Consiculine?

The CAS number of Consiculine is 219829-73-9.

What are some synonyms of Consiculine?

Some synonyms of Consiculine are 2-Cyclohexene-1-carboxylic acid, 1,6-dihydroxy-3-(3-methyl-2-buten-1-yl)-4-oxo-, and (1R,6R)-.

What is the predicted boiling point of Consiculine?

The predicted boiling point of Consiculine is 499.7±45.0 °C.

What is the predicted density of Consiculine?

The predicted density of Consiculine is 1.24±0.1 g/cm3.

What is the predicted pKa value of Consiculine?

The predicted pKa value of Consiculine is 10.71±0.60.

How is Consiculine classified based on its molecular structure?

Consiculine is classified as a bicyclic alkaloid.

Can Consiculine be used in pharmaceutical research?

Yes, Consiculine can be used in pharmaceutical research.

Is Consiculine commercially available or is it a research chemical?

Consiculine is more likely to be a research chemical rather than a commercially available product.

※ Please kindly note that our products are for research use only.