Coptisine

Coptisine

Inquiry
Catalog Number ACM3486666
CAS Number 3486-66-6 / 1198398-71-8
Synonyms Coptisine sulfate
Molecular Weight 320.3
InChI InChI=1S/C19H14NO4/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14/h1-2,5-8H,3-4,9-10H2/q+1
InChI Key XYHOBCMEDLZUMP-UHFFFAOYSA-N
Melting Point 212-217 °C
Purity 90%+
Complexity 502
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 320.09228293
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Monoisotopic Mass 320.09228293
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the molecular formula of COPTISINE?

The molecular formula of COPTISINE is C19H14NO4+.

What is the melting point of COPTISINE?

The melting point of COPTISINE is 212-217 °C.

In which solvents is COPTISINE soluble?

COPTISINE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the storage temperature recommended for COPTISINE?

COPTISINE should be stored at 2-8°C.

What is the hazard associated with COPTISINE?

COPTISINE is considered a poison.

What is the chemical property of COPTISINE?

COPTISINE is in the form of a powder.

Where is COPTISINE found naturally?

COPTISINE is found in Coptis japonica.

What is the hazardous substances data for COPTISINE?

The hazardous substances data for COPTISINE is 3486-66-6.

What are the synonyms for COPTISINE?

Some synonyms for COPTISINE include Coptisin, 5,6-Dihydro-2,3:9,10-bis(methylenedioxy)dibenzo[a,g]quinolizinium, and Coptisine Sulfate.

How does COPTISINE behave when heated to decomposition?

When heated to decomposition, COPTISINE emits toxic vapors of NOx.

※ Please kindly note that our products are for research use only.