Coptisine sulfate

Catalog Number	ACM1198398718
CAS Number	1198398-71-8
Structure
Description	Coptisine sulfate is a natural compound that belongs to the group of plant alkaloids. It has been shown to have anti-inflammatory properties, significant cytotoxicity, and significant mitochondrial membrane potential in myeloma cells. Coptisine sulfate inhibits toll-like receptor 4 (TLR4), which is a protein present on the surface of immune cells. Coptisine sulfate has been shown to inhibit the production of cytokines such as tumor necrosis factor alpha (TNF-α) and IL-6 by these cells. Coptisine sulfate also inhibits the activation of nuclear factor kappa B (NFκB) and mitogen activated protein kinase (MAPK). This inhibition leads to reduced levels of proinflammatory cytokines and chemokines, such as IL-1β, IL-8, MCP1, and GROα.
Molecular Weight	736.7 g/mol
Molecular Formula	C38H28N2O12S
Canonical SMILES	C1C[N+]2=C(C=C3C=CC4=C(C3=C2)OCO4)C5=CC6=C(C=C51)OCO6

Custom Q&A

What is the chemical name of the compound referred to as COPTISINE?

The chemical name of the compound referred to as COPTISINE is Coptisine sulfate.

What are some synonyms of COPTISINE?

Some synonyms of COPTISINE are Coptisin and Coptisine Sulfate.

What is the molecular formula of COPTISINE?

The molecular formula of COPTISINE is C19H14NO4+.

What is the molecular weight of COPTISINE?

The molecular weight of COPTISINE is 320.32.

In what categories is COPTISINE classified as a product?

COPTISINE is classified as a chemical reagent, pharmaceutical intermediate, alkaloids, phytochemical, and standardized herbal extract.

At what temperature does COPTISINE melt?

COPTISINE melts at a temperature of 212-217 °C.

What are some solvents in which COPTISINE is soluble?

COPTISINE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone, among others.

What is the storage temperature recommended for COPTISINE?

The recommended storage temperature for COPTISINE is 2-8°C.

Where is COPTISINE found naturally?

COPTISINE is a natural product found in Coptis japonica.

What is the safety profile of COPTISINE?

COPTISINE is considered a poison by ingestion and emits toxic vapors of NOx when heated to decomposition.

※ Please kindly note that our products are for research use only.