Cordycepin

Catalog Number	ACM73030-4
CAS Number	73-03-0
Synonyms	3'-Deoxyadenosine
IUPAC Name	(2R,3R,5S)-2-(6-Aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol
Molecular Weight	251.24
Molecular Formula	C10H13N5O3
Canonical SMILES	C1C(OC(C1O)N2C=NC3=C(N=CN=C32)N)CO
InChI	InChI=1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,10+/m0/s1
InChI Key	OFEZSBMBBKLLBJ-BAJZRUMYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	307
Exact Mass	251.10183929
Heavy Atom Count	18
Isomeric SMILES	C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C(N=CN=C32)N)CO
Monoisotopic Mass	251.10183929
Topological Polar Surface Area	119Ų

Custom Q&A

What is the chemical name of cordycepin?

The chemical name of cordycepin is 3'-deoxyadenosine.

What is the molecular formula of cordycepin?

The molecular formula of cordycepin is C10H13N5O3.

What is the boiling point of cordycepin?

The boiling point of cordycepin is approximately 394.4°C.

What are some of the safety hazards associated with cordycepin?

The safety hazards associated with cordycepin include Xn (harmful), T (toxic), and risk statements 40-36/37/38-25-20/21/22.

What are the major pharmacological effects of cordycepin?

Cordycepin has anti-tumor, antibacterial, antiviral, immunomodulatory, and free radical-scavenging effects.

How is cordycepin mainly used in clinical applications?

Cordycepin is mainly used as an adjuvant treatment for malignant tumors, including nasal cancer, throat cancer, lung cancer, leukemia, and brain cancer.

What are some of the reported uses of cordycepin?

Cordycepin is known to have various effects on improving immune function, anti-aging, anti-fatigue, anti-cancer, anti-bacterial, and lowering blood glucose and lipid levels.

What is the biological activity of cordycepin?

Cordycepin acts as an anticancer and antifungal agent and can inhibit the growth of various tumor cells in vitro.

How can cordycepin be stored?

Cordycepin should be stored in a dark place, in an inert atmosphere, and under -20°C.

What are the references provided that discuss the effects of cordycepin on different biological processes?

The references provided include studies on the anti-inflammatory, neuroprotective, anti-obesity, and stem cell pluripotency effects of cordycepin.

※ Please kindly note that our products are for research use only.