(-)-Corlumine

Catalog Number	ACM79082647
CAS Number	79082-64-7
IUPAC Name	(6S)-6-[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]-6H-furo[3,4-g][1,3]benzodioxol-8-one
Molecular Weight	383.39
Molecular Formula	C21H21NO6
Canonical SMILES	CN1CCC2=CC(=C(C=C2[C@@H]1[C@@H]3C4=C(C5=C(C=C4)OCO5)C(=O)O3)OC)OC
InChI	InChI=1S/C21H21NO6/c1-22-7-6-11-8-15(24-2)16(25-3)9-13(11)18(22)19-12-4-5-14-20(27-10-26-14)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3/t18-,19+/m1/s1
InChI Key	SZDGAZFTAUFFQH-MOPGFXCFSA-N
Melting Point	158-160 °C
Purity	98%
Appearance	Solid
Complexity	601
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	383.13688739
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CCC2=CC(=C(C=C2[C@@H]1[C@@H]3C4=C(C5=C(C=C4)OCO5)C(=O)O3)OC)OC
Monoisotopic Mass	383.13688739
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	66.5 Ų

Custom Q&A

What is the chemical name of (-)-CorluMine?

The chemical name of (-)-CorluMine is Furo[3,4-e]-1,3-benzodioxol-8(6H)-one, 6-[(1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl]-, (6S)-.

What is the CAS number of (-)-CorluMine?

The CAS number of (-)-CorluMine is 79082-64-7.

What is the molecular formula of (-)-CorluMine?

The molecular formula of (-)-CorluMine is C21H21NO6.

What is the molecular weight of (-)-CorluMine?

The molecular weight of (-)-CorluMine is 383.39.

What is the melting point of (-)-CorluMine?

The melting point of (-)-CorluMine is 158-160℃ (Decomposition).

What is the predicted boiling point of (-)-CorluMine?

The predicted boiling point of (-)-CorluMine is 542.1±50.0 °C.

What is the predicted density of (-)-CorluMine?

The predicted density of (-)-CorluMine is 1.339±0.06 g/cm3.

What is the predicted pka of (-)-CorluMine?

The predicted pka of (-)-CorluMine is 6.71±0.40.

How many methoxy groups are present in the chemical structure of (-)-CorluMine?

There are two methoxy groups present in the chemical structure of (-)-CorluMine.

What is the stereochemistry of (-)-CorluMine?

The stereochemistry of (-)-CorluMine is (6S)-.

※ Please kindly note that our products are for research use only.