Corydalmine

Catalog Number	ACM30413844
CAS Number	30413-84-4
Structure
Synonyms	(13aS)-2,3,9-Trimethoxy-5,8,13,13a-tetrahydro-6H-isoquinolino[3,2-a]isoquinolin-10-ol
Molecular Weight	341.4
InChI	InChI=1S/C20H23NO4/c1-23-18-9-13-6-7-21-11-15-12(4-5-17(22)20(15)25-3)8-16(21)14(13)10-19(18)24-2/h4-5,9-10,16,22H,6-8,11H2,1-3H3/t16-/m0/s1
InChI Key	DIHXHTWYVOYYDC-INIZCTEOSA-N
Melting Point	177-178 °C
Purity	95%+
Complexity	461
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	341.16270821
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	COC1=C(C=C2[C@@H]3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)OC)OC
Monoisotopic Mass	341.16270821
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	51.2 Ų

Custom Q&A

What is the molecular formula of corydalmine?

The molecular formula of corydalmine is C20H23NO4.

What is the molecular weight of corydalmine?

The molecular weight of corydalmine is 341.4.

What is the CAS number of corydalmine?

The CAS number of corydalmine is 30413-84-4.

At what temperature does corydalmine melt?

Corydalmine melts at a temperature of 177-178℃.

What is the predicted boiling point of corydalmine?

The predicted boiling point of corydalmine is 501.2±50.0 °C.

In what solvents is corydalmine soluble?

Corydalmine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the storage temperature recommended for corydalmine?

The recommended storage temperature for corydalmine is at -20°C.

What form does corydalmine usually come in?

Corydalmine usually comes in the form of a powder.

What is the predicted pKa value of corydalmine?

The predicted pKa value of corydalmine is 9.97±0.20.

What is one of the suggested targets for corydalmine's usage and synthesis?

One of the suggested targets for corydalmine's usage and synthesis is P450 (e.g. CYP17) for antifection purposes.

※ Please kindly note that our products are for research use only.