Corynoline

Corynoline

Inquiry
Catalog Number ACM18797790
CAS Number 18797-79-0
Structure
Synonyms 13-Methylchelidonan-11β-ol
Molecular Weight 367.4
InChI InChI=1S/C21H21NO5/c1-21-14-3-4-15-19(27-10-24-15)13(14)8-22(2)20(21)12-7-17-16(25-9-26-17)5-11(12)6-18(21)23/h3-5,7,18,20,23H,6,8-10H2,1-2H3/t18-,20+,21-/m0/s1
InChI Key IQUGPRHKZNCHGC-TYPHKJRUSA-N
Melting Point 180-181 °C
Purity 95%+
Complexity 603
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 3
Exact Mass 367.14197277
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 1
Isomeric SMILES C[C@]12[C@H](CC3=CC4=C(C=C3[C@H]1N(CC5=C2C=CC6=C5OCO6)C)OCO4)O
Monoisotopic Mass 367.14197277
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 60.4 Ų
Custom Q&A

What is the molecular formula of corynoline?

The molecular formula of corynoline is C21H21NO5.

What is the melting point of corynoline?

The melting point of corynoline is 180-181°C.

What are the reported pharmacological activities of corynoline?

Reported pharmacological activities of corynoline include cell adhesion inhibition, sedation, and liver protection.

How is corynoline stored?

Corynoline is stored in an Amber Vial, -20°C Freezer, under an inert atmosphere.

What is the solubility of corynoline in chloroform and ethyl acetate?

Corynoline is slightly soluble in chloroform and slightly soluble in heated ethyl acetate.

What is the safety statement for corynoline?

The safety statement for corynoline is 24/25.

What is the chemical category of corynoline?

Corynoline falls under the categories of chemical reagent, pharmaceutical intermediate, phytochemical, reference standards from Chinese medicinal herbs (TCM), and standardized herbal extract.

What is the structure of corynoline?

Corynoline is a benzophenanthridine alkaloid that is chelidonine substituted by a methyl group at position 13.

What is the boiling point of corynoline?

The predicted boiling point of corynoline is 504.2±50.0°C.

What is the color of corynoline?

Corynoline is off-white to pale yellow in color.

※ Please kindly note that our products are for research use only.