Corynoxine B

Catalog Number	ACM17391183
CAS Number	17391-18-3
Molecular Weight	384.5
InChI	InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26)/b16-13+/t14-,15+,19+,22-/m1/s1
InChI Key	DAXYUDFNWXHGBE-XYEDMTIPSA-N
Purity	98%+
Complexity	663
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	384.20490738
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@@H]1CN2CC[C@]3([C@@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)C4=CC=CC=C4NC3=O
Monoisotopic Mass	384.20490738
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	67.9 Ų

Custom Q&A

What is the boiling point of Corynoxine B?

The boiling point of Corynoxine B is 560.8±50.0 °C (Predicted).

What is the density of Corynoxine B?

The density of Corynoxine B is 1.23±0.1 g/cm3 (Predicted).

What is the storage temperature recommended for Corynoxine B?

Corynoxine B should be stored at -20°C.

What is the solubility of Corynoxine B in DMSO?

Corynoxine B is soluble in DMSO at 83.33 mg/mL (216.74 mM).

What is the pka value of Corynoxine B?

The pka value of Corynoxine B is 13.61±0.60 (Predicted).

Where is Corynoxine B isolated from?

Corynoxine B is an oxindole alkaloid isolated from Uncaria rhynchophylla (Miq.) Jacks (Gouteng in Chinese).

What is the role of Corynoxine B as mentioned in the usage and synthesis section?

Corynoxine B is mentioned as a Beclin-1-dependent autophagy inducer.

What is the Chemical Entity of Corynoxine B according to ChEBI?

According to ChEBI, Corynoxine B is a member of indolizines.

What is the molecular formula of Corynoxine B?

The molecular formula of Corynoxine B is C22H28N2O4.

What is the molecular weight of Corynoxine B?

The molecular weight of Corynoxine B is 384.48.

※ Please kindly note that our products are for research use only.