Corynoxine

Catalog Number	ACM6877323
CAS Number	6877-32-3
Structure
Synonyms	(16E)-16,17-Didehydro-17-methoxy-2-oxocorynoxan-16-carboxylic acid methyl ester
IUPAC Name	Methyl (E)-2-[(3S,6'S,7'S,8'aS)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate
Molecular Weight	384.47
Molecular Formula	C22H28N2O4
Canonical SMILES	CC[C@@H]1CN2CC[C@@]3([C@@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)C4=CC=CC=C4NC3=O
InChI	InChI=1S/C22H28N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h5-8,13-15,19H,4,9-12H2,1-3H3,(H,23,26)/b16-13+/t14-,15+,19+,22+/m1/s1
InChI Key	DAXYUDFNWXHGBE-NRAMRBJXSA-N
Boiling Point	560.8±50.0 °C
Melting Point	166-168 °C
Purity	98%
Density	1.23 g/ml
Appearance	Powder
Complexity	663
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	384.20490738
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@@H]1CN2CC[C@@]3([C@@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)C4=CC=CC=C4NC3=O
Monoisotopic Mass	384.20490738
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	67.9 Ų

Custom Q&A

What is the chemical formula of Corynoxine?

The chemical formula of Corynoxine is C22H28N2O4.

What is the molecular weight of Corynoxine?

The molecular weight of Corynoxine is 384.47 g/mol.

What is the melting point of Corynoxine?

The melting point of Corynoxine is 166-168℃.

What is the boiling point of Corynoxine?

The boiling point of Corynoxine is 560.8±50.0 °C (Predicted).

What is the storage temperature recommended for Corynoxine?

Corynoxine should be stored at -20°C.

What is the solubility of Corynoxine in DMSO?

Corynoxine is soluble in DMSO at a concentration of ≥ 100 mg/mL (260.10 mM).

What is the form of Corynoxine?

Corynoxine is in crystalline form.

What is the pKa value of Corynoxine?

The pKa value of Corynoxine is 13.61±0.60 (Predicted).

What is the main usage of Corynoxine?

Corynoxine is an indole alkaloid extracted from Uncaria plants, known to affect locomotor response in mice and mediate the central dopaminergic system.

In which plant is Corynoxine naturally found?

Corynoxine is naturally found in Uncaria macrophylla.

※ Please kindly note that our products are for research use only.