Coryximine

Catalog Number	ACM127460611
CAS Number	127460-61-1
IUPAC Name	5-[[(5R)-6-Methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]methyl]-1,3-benzodioxole-4-carboxylic acid
Molecular Weight	369.4
Molecular Formula	C20H19NO6
Canonical SMILES	CN1CCC2=CC3=C(C=C2C1CC4=C(C5=C(C=C4)OCO5)C(=O)O)OCO3
InChI	InChI=1S/C20H19NO6/c1-21-5-4-11-7-16-17(26-9-25-16)8-13(11)14(21)6-12-2-3-15-19(27-10-24-15)18(12)20(22)23/h2-3,7-8,14H,4-6,9-10H2,1H3,(H,22,23)/t14-/m1/s1
InChI Key	MVXPONFJJHYSIL-CQSZACIVSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	573
Exact Mass	369.12123733
Heavy Atom Count	27
Isomeric SMILES	CN1CCC2=CC3=C(C=C2[C@H]1CC4=C(C5=C(C=C4)OCO5)C(=O)O)OCO3
Monoisotopic Mass	369.12123733
Topological Polar Surface Area	77.5Ų

Custom Q&A

What is the chemical name of Coryximine?

The chemical name of Coryximine is 2,3-Dihydro-6-[[[(5R)-5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin]-5β-yl]methyl]benzofuran-7-carboxylic acid.

What is the CAS number of Coryximine?

The CAS number of Coryximine is 127460-61-1.

What is the molecular formula of Coryximine?

The molecular formula of Coryximine is C20H19NO6.

What is the molecular weight of Coryximine?

The molecular weight of Coryximine is 369.37 g/mol.

What is the boiling point of Coryximine?

The predicted boiling point of Coryximine is 531.5±50.0 °C.

What is the density of Coryximine?

The predicted density of Coryximine is 1.417±0.06 g/cm3.

What is the pka value of Coryximine?

The predicted pka value of Coryximine is 3.73±0.20.

Is Coryximine a naturally occurring compound?

, Coryximine is a compound that may have natural origins.

What is the chemical structure of Coryximine?

The chemical structure of Coryximine includes a benzofuran ring attached to a tetrahydroisoquinoline moiety through a carboxylic acid linker.

※ Please kindly note that our products are for research use only.