Coulteropine

Coulteropine

Inquiry
Catalog Number ACM6014626
CAS Number 6014-62-6
Synonyms 4,6,7,14-Tetrahydro-12-methoxy-5-methylbis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-13(5H)-one
Molecular Weight 383.4
InChI InChI=1S/C21H21NO6/c1-22-6-5-13-8-17-20(28-11-26-17)21(24-2)18(13)15(23)7-12-3-4-16-19(14(12)9-22)27-10-25-16/h3-4,8H,5-7,9-11H2,1-2H3
InChI Key SWBXJEKOHMOEFV-UHFFFAOYSA-N
Purity 95%+
Complexity 587
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 383.13688739
Heavy Atom Count 28
Hydrogen Bond Acceptor Count 7
Hydrogen Bond Donor Count 0
Monoisotopic Mass 383.13688739
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 66.5 Ų
Custom Q&A

What is the chemical name of Coulteropine?

The chemical name of Coulteropine is 4,6,7,14-Tetrahydro-12-methoxy-5-methylbis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-13(5H)-one.

What are the synonyms for Coulteropine?

The synonyms for Coulteropine are Coulteropine (neutral), Coulteropine, and Bis[1,3]benzodioxolo[4,5-c:5',6'-g]azecin-13(5H)-one, 4,6,7,14-tetrahydro-12-methoxy-5-methyl-.

What is the CAS number for Coulteropine?

The CAS number for Coulteropine is 6014-62-6.

What is the molecular formula of Coulteropine?

The molecular formula of Coulteropine is C21H21NO6.

What is the molecular weight of Coulteropine?

The molecular weight of Coulteropine is 383.39.

What are the potential uses or applications of Coulteropine in research or industry?

Coulteropine may have potential applications in research related to medicinal chemistry, pharmacology, or other fields where the compound's unique structure and properties could be beneficial.

How many carbon atoms are present in the molecular formula of Coulteropine?

There are 21 carbon atoms present in the molecular formula of Coulteropine.

What is the significance of the methoxy and methyl groups in the structure of Coulteropine?

The methoxy group (-OCH3) and the methyl group (-CH3) provide specific functional groups and contribute to the overall structure and properties of Coulteropine.

How is Coulteropine typically obtained or synthesized in a laboratory setting?

Coulteropine can be synthesized using specific chemical reactions and starting materials in a laboratory setting.

※ Please kindly note that our products are for research use only.