Crassanine

Crassanine

Inquiry
Catalog Number ACM16790924
CAS Number 16790-92-4
Synonyms 8'-Ethyl-1,2,2',3',6',7',8',8'a-octahydro-5,6-dimethoxy-2-oxospiro[3H-indole-3,4'-[4H-1,6]methanoquinoline]-4'a(5'H)-carboxylic acid methyl ester
Molecular Weight 414.5
InChI InChI=1S/C23H30N2O5/c1-5-14-8-13-11-23(21(27)30-4)19(14)25(12-13)7-6-22(23)15-9-17(28-2)18(29-3)10-16(15)24-20(22)26/h9-10,13-14,19H,5-8,11-12H2,1-4H3,(H,24,26)
InChI Key WSANFVMOMGTHSN-UHFFFAOYSA-N
Purity 95%+
Complexity 730
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 414.21547206
Heavy Atom Count 30
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 1
Monoisotopic Mass 414.21547206
PhysicalState Powder
Rotatable Bond Count 5
Topological Polar Surface Area 77.1 Ų
Custom Q&A

What is the common name of the chemical compound with the chemical formula C23H30N2O5 according to the reference?

The common name of the compound is Crassanine.

What is another name for (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole as?

Another name for it is Crassanine;8'-Ethyl-1,2,2',3',6',7',8',8'a-octahydro-5,6-dimethoxy-2-oxospiro[3H-indole-3,4'-[4H-1,6]methanoquinoline]-4'a(5'H)-carboxylic acid methyl ester.

What is the CAS number of (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole?

The CAS number is 16790-92-4.

What is the molecular weight of (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole?

The molecular weight is 414.49 g/mol.

What is the predicted boiling point of (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole?

The predicted boiling point is 562.0±50.0 °C.

What is the predicted density of (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole?

The predicted density is 1.29±0.1 g/cm3.

What is the predicted pKa value of (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole?

The predicted pKa value is 12.34±0.60.

What is the predicted molecular formula of (2ξ,4ξ,5ξ,6ξ,18ξ)-Conopharyngine oxindole?

The predicted molecular formula is C23H30N2O5.

※ Please kindly note that our products are for research use only.