Crinine

Catalog Number	ACM510678
CAS Number	510-67-8
Synonyms	(3R)-1,2-Didehydrocrinan-3-ol
Molecular Weight	271.31
InChI	InChI=1S/C16H17NO3/c18-11-1-2-16-3-4-17(15(16)6-11)8-10-5-13-14(7-12(10)16)20-9-19-13/h1-2,5,7,11,15,18H,3-4,6,8-9H2/t11-,15+,16+/m0/s1
InChI Key	RPAORVSEYNOMBR-IUIKQTSFSA-N
Purity	95%+
Complexity	453
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	271.1208434
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1CN2CC3=CC4=C(C=C3[C@]15[C@H]2C[C@H](C=C5)O)OCO4
Monoisotopic Mass	271.1208434
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	41.9 Ų

Custom Q&A

What is the chemical name of (-)-Crinine?

The chemical name of (-)-Crinine is (3R)-1,2-Didehydrocrinan-3-ol.

What is the molecular formula of (-)-Crinine?

The molecular formula of (-)-Crinine is C16H17NO3.

What is the molecular weight of (-)-Crinine?

The molecular weight of (-)-Crinine is 271.31.

What is the CAS number of (-)-Crinine?

The CAS number of (-)-Crinine is 510-67-8.

What are some synonyms for (-)-Crinine?

Some synonyms for (-)-Crinine include Crinidine and Crinine[C16 alkaloid].

What is the predicted boiling point of (-)-Crinine?

The predicted boiling point of (-)-Crinine is 456.3±45.0 °C.

What is the predicted density of (-)-Crinine?

The predicted density of (-)-Crinine is 1.43±0.1 g/cm3.

What is the predicted pka value of (-)-Crinine?

The predicted pka value of (-)-Crinine is 14.03±0.20.

What is the chemical structure of (-)-Crinine?

The chemical structure of (-)-Crinine is 3H,6H-5,11b-Ethano[1,3]dioxolo[4,5-j]phenanthridin-3-ol, 4,4a-dihydro-, (3R,4aR,5S,11bS)-.

What type of alkaloid is (-)-Crinine?

(-)-Crinine is classified as a C16 alkaloid.

※ Please kindly note that our products are for research use only.