Crispine A

Catalog Number	ACM15889937
CAS Number	15889-93-7
Description	Tricyclic indolizidine alkaloid; α2-adrenoceptor antagonist
Synonyms	1,2,3,5,6,10b-Hexahydro-8,9-dimethoxypyrrolo[2,1-a]isoquinoline
Molecular Weight	233.31 g/mol
Molecular Formula	C14H19NO2
Canonical SMILES	COC1=C(C=C2C3CCCN3CCC2=C1)OC

Custom Q&A

What is the chemical formula of Crispine A?

The chemical formula of Crispine A is C14H19NO2.

What is the molecular weight of Crispine A?

The molecular weight of Crispine A is 233.31 g/mol.

What is the CAS number of Crispine A?

The CAS number of Crispine A is 15889-93-7.

What are some synonyms of Crispine A?

Some synonyms of Crispine A are Pyrrolo[2,1-a]isoquinoline, 1,2,3,5,6,10b-hexahydro-8,9-dimethoxy- and 8,9-Dimethoxy-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.

What is the melting point of Crispine A?

The melting point of Crispine A is 87-88 °C.

What is the boiling point of Crispine A?

The boiling point of Crispine A is 110-120 °C at a pressure of 0.02 Torr.

What is the predicted density of Crispine A?

The predicted density of Crispine A is 1.15±0.1 g/cm3.

What is the predicted pka value of Crispine A?

The predicted pka value of Crispine A is 8.31±0.20.

What are the product categories that Crispine A belongs to?

Crispine A belongs to the product categories of Amines, Aromatics, Heterocycles, Pharmaceuticals, Intermediates & Fine Chemicals.

What is the usage of Crispine A?

Crispine A is a tricyclic indolizidine alkaloid used as a potent α2-adrenoceptor antagonist.

※ Please kindly note that our products are for research use only.