Crotaleschenine

Catalog Number	ACM120154952
CAS Number	120154-95-2
Molecular Weight	309.36
InChI	InChI=1S/C16H23NO5/c1-9-10(2)16(3,20)15(19)21-8-11-4-6-17-7-5-12(13(11)17)22-14(9)18/h4,9-10,12-13,20H,5-8H2,1-3H3/t9-,10+,12-,13-,16-/m1/s1
InChI Key	QPNKYNYIKKVVQB-RCJVZNENSA-N
Purity	95%+
Complexity	531
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	309.15762283
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1[C@@H]([C@@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(C)O)C
Monoisotopic Mass	309.15762283
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical name of Crotaleschenine?

The chemical name of Crotaleschenine is 2H-[1,6]Dioxacycloundecino[2,3,4-gh]pyrrolizine-2,6(3H)-dione, 4,5,8,10,12,13,13a,13b-octahydro-5-hydroxy-3,4,5-trimethyl-, (3R,4S,5R,13aR,13bR)-.

What is the CAS number of Crotaleschenine?

The CAS number of Crotaleschenine is 120154-95-2.

What is the molecular formula of Crotaleschenine?

The molecular formula of Crotaleschenine is C16H23NO5.

What is the molecular weight of Crotaleschenine?

The molecular weight of Crotaleschenine is 309.36 g/mol.

What is the boiling point of Crotaleschenine?

The boiling point of Crotaleschenine is predicted to be 532.0±50.0 °C.

What is the predicted density of Crotaleschenine?

The predicted density of Crotaleschenine is 1.27±0.1 g/cm3.

What is the predicted pKa of Crotaleschenine?

The predicted pKa of Crotaleschenine is 12.69±0.60.

How many hydrogen atoms are present in the molecular formula of Crotaleschenine?

There are 23 hydrogen atoms present in the molecular formula of Crotaleschenine.

What are some synonyms for Crotaleschenine?

Some synonyms for Crotaleschenine include Crotaleschenine and 2H-[1,6]Dioxacycloundecino[2,3,4-gh]pyrrolizine-2,6(3H)-dione.

※ Please kindly note that our products are for research use only.