Crotananine

Catalog Number	ACM71295288
CAS Number	71295-28-8
Synonyms	(13ξ)-15,20-Dihydro-12-hydroxy-14-methyl-18,21-dinorsenecionan-11,16-dione
Molecular Weight	323.4
InChI	InChI=1S/C17H25NO5/c1-9-10(2)15(19)17(21)22-8-12-4-6-18-7-5-13(14(12)18)23-16(20)11(9)3/h4,9-11,13-15,19H,5-8H2,1-3H3/t9,10,11,13-,14-,15/m1/s1
InChI Key	GFXWTYYPYYHXDK-GLDVEYQJSA-N
Purity	95%+
Complexity	531
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	323.1732729
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC1C(C(C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC(=O)C1C)O)C
Monoisotopic Mass	323.1732729
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical name of CROTANANINE?

The chemical name of CROTANANINE is (13ξ)-15,20-Dihydro-12-hydroxy-14-methyl-18,21-dinorsenecionan-11,16-dione.

What type of compound is CROTANANINE?

CROTANANINE is a pyrrolizidine alkaloid.

What is the specific rotation of CROTANANINE?

The specific rotation of CROTANANINE is [α]D23 -800 (c 1.02, MeOH).

In which plant extract can crotananine be found?

Crotananine occurs in the extract of Crotalaria nana.

What is the molecular formula of CROTANANINE?

The molecular formula of CROTANANINE is C17H25NO5.

What are the synonyms for CROTANANINE?

The synonyms for CROTANANINE are (13ξ)-15,20-Dihydro-12-hydroxy-14-methyl-18,21-dinorsenecionan-11,16-dione and [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-3,4,5-trimethyl-, (14aR,14bR)-.

What is the CAS number of CROTANANINE?

The CAS number of CROTANANINE is 71295-28-8.

How does CROTANANINE appear when crystallized from AcOEt?

CROTANANINE furnishes colourless needles when crystallized from AcOEt.

What is the molecular weight of CROTANANINE?

The molecular weight of CROTANANINE is 323.38.

What is the chemical formula of CROTANANINE?

The chemical formula of CROTANANINE is C17H25NO5.

※ Please kindly note that our products are for research use only.