Crotaverrine

Catalog Number	ACM60827692
CAS Number	60827-69-2
Molecular Weight	365.4
InChI	InChI=1S/C19H27NO6/c1-5-13-10-12(2)19(3,24)18(23)25-11-14-6-8-20(4)9-7-15(16(14)21)26-17(13)22/h5-6,12,15,24H,7-11H2,1-4H3/b13-5+,14-6-/t12-,15-,19+/m1/s1
InChI Key	HPDHKHMHQGCNPE-AGYIUGPWSA-N
Purity	95%+
Complexity	652
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	365.18383758
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\C[C@H]([C@](C(=O)OC/C/2=C/CN(CC[C@H](C2=O)OC1=O)C)(C)O)C
Monoisotopic Mass	365.18383758
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	93.1 Ų

Custom Q&A

What is the product name of the compound NEOSENKIRKINE?

The product name of the compound NEOSENKIRKINE is NEOSENKIRKINE.

What are some synonyms of NEOSENKIRKINE?

Some synonyms of NEOSENKIRKINE are Crotaverrine and (15E)-12-Hydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione.

What is the CAS number of NEOSENKIRKINE?

The CAS number of NEOSENKIRKINE is 57194-70-4.

What is the molecular formula of NEOSENKIRKINE?

The molecular formula of NEOSENKIRKINE is C19H27NO6.

What is the molecular weight of NEOSENKIRKINE?

The molecular weight of NEOSENKIRKINE is 365.42.

What is the boiling point of NEOSENKIRKINE?

The boiling point of NEOSENKIRKINE is predicted to be 604.9±55.0 °C.

What is the density of NEOSENKIRKINE?

The density of NEOSENKIRKINE is predicted to be 1.22±0.1 g/cm3.

What is the pka value of NEOSENKIRKINE?

The pka value of NEOSENKIRKINE is predicted to be 12.67±0.40.

Where has neosenkirkine been isolated from?

Neosenkirkine has been isolated from Senecio auricula.

What is the structure of neosenkirkine based upon?

The structure of neosenkirkine is based upon chemical and spectroscopic data.

※ Please kindly note that our products are for research use only.