Cyclanoline iodide

Catalog Number	ACM17472514
CAS Number	17472-51-4
Structure
Description	Cyclanoline iodide is a phenolate that has been shown to have hydrophobic properties. It is soluble in benzene, but not in water. Cyclanoline iodide has a chromophore that shifts from blue to red when exposed to light or ultraviolet radiation. The compound also shows hypsochromic and fluorescence properties. Cyclanoline iodide is related to natural products, such as the aporphine alkaloids, which are found in plants of the Papaveraceae family and are known for their fluorescence properties.
Molecular Weight	469.31 g/mol
Molecular Formula	C20H24NO4·I
Canonical SMILES	[I-].COc1ccc2C[C@H]3c4cc(O)c(OC)cc4CC[N@@+]3(C)Cc2c1O
Storage	store at 10℃-25℃
MDL Number	MFCD31726201

Custom Q&A

What is the chemical formula for Cyclanoline iodide?

The chemical formula for Cyclanoline iodide is C20H24INO4.

What is the molecular weight of Cyclanoline iodide?

The molecular weight of Cyclanoline iodide is 469.31 g/mol.

What are some synonyms for Cyclanoline iodide?

Some synonyms for Cyclanoline iodide include CYCLANOLINE IODIDE.

What is the molecular formula of Cyclanoline iodide?

The molecular formula of Cyclanoline iodide is C20H24INO4.

What is the structure of Cyclanoline iodide?

The structure of Cyclanoline iodide consists of 20 carbon atoms, 24 hydrogen atoms, 1 iodine atom, and 4 oxygen atoms.

How is Cyclanoline iodide classified chemically?

Cyclanoline iodide is classified as an organic compound containing iodine.

What is the molar mass of Cyclanoline iodide?

The molar mass of Cyclanoline iodide is 469.31 g/mol.

Can Cyclanoline iodide be used in pharmaceuticals?

Yes, Cyclanoline iodide can be used in pharmaceuticals due to its chemical properties.

※ Please kindly note that our products are for research use only.