Cycleanine

Cycleanine

Inquiry
Catalog Number ACM518945
CAS Number 518-94-5
Structure
Synonyms 7,7'-O,O-Dimethylisochondodendrine
Molecular Weight 622.7
Molecular Formula C38H42N2O6
InChI InChI=1S/C38H42N2O6/c1-39-17-15-25-21-31(41-3)35(43-5)37-33(25)29(39)19-23-7-11-28(12-8-23)46-38-34-26(22-32(42-4)36(38)44-6)16-18-40(2)30(34)20-24-9-13-27(45-37)14-10-24/h7-14,21-22,29-30H,15-20H2,1-6H3/t29-,30-/m1/s1
InChI Key ANOXEUSGZWSCQL-LOYHVIPDSA-N
Purity 95%+
Density 1.172g/cm³
Complexity 895
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 2
Exact Mass 622.30428706
Heavy Atom Count 46
Hydrogen Bond Acceptor Count 8
Hydrogen Bond Donor Count 0
Isomeric SMILES CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC=C(O3)C=C7)N(CCC6=CC(=C5OC)OC)C)OC)OC
Monoisotopic Mass 622.30428706
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 61.9 Ų
Custom Q&A

What is the chemical formula for Cycleanine?

The chemical formula for Cycleanine is C38H42N2O6.

What is the molecular weight of Cycleanine?

The molecular weight of Cycleanine is 622.75 g/mol.

What is the melting point of Cycleanine?

The melting point of Cycleanine is 272-273 °C.

In which medicinal plant is Cycleanine obtained from?

Cycleanine is obtained from the Triclisia subcordata Oliv.

What is the in-vitro activity of Cycleanine?

It displays in-vitro anti-ovarian cancer activity.

What is the storage temperature recommended for Cycleanine?

The recommended storage temperature for Cycleanine is 4°C, away from moisture and light.

In which solvents is Cycleanine soluble?

Cycleanine is soluble in Acetone, Dichloromethane, DMSO, and Ethyl Acetate.

What is the predicted boiling point of Cycleanine?

The predicted boiling point of Cycleanine is 691.6±55.0 °C.

What is the predicted pKa of Cycleanine?

The predicted pKa of Cycleanine is 7.56±0.20.

What are some synonyms for Cycleanine?

Some synonyms for Cycleanine include Dimethylisochondodendrine and o,o-Dimethylisochondodendrin.

※ Please kindly note that our products are for research use only.