Cyclo(Ala-Phe)

Catalog Number	ACM14474783
CAS Number	14474-78-3
Synonyms	3-Benzyl-6-methyl-2,5-piperazinedione
IUPAC Name	3-Benzyl-6-methylpiperazine-2,5-dione
Molecular Weight	218.25
Molecular Formula	C12H14N2O2
Canonical SMILES	CC1C(=O)NC(C(=O)N1)CC2=CC=CC=C2
InChI	InChI=1S/C12H14N2O2/c1-8-11(15)14-10(12(16)13-8)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,13,16)(H,14,15)
InChI Key	CNXWPOWVDIUTPS-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	285
Exact Mass	218.105527694
Heavy Atom Count	16
Monoisotopic Mass	218.105527694
Topological Polar Surface Area	58.2Ų

Custom Q&A

What is the chemical name of the compound Cyclo(Ala-Phe)?

The chemical name of the compound Cyclo(Ala-Phe) is cis-cyclo(?-Ala-?-Phe).

What are some synonyms for Cyclo(Ala-Phe)?

Some synonyms for Cyclo(Ala-Phe) are Cyclo(Phe-Ala) and 2,5-Piperazinedione, 3-methyl-6-(phenylmethyl)-.

What is the CAS number of Cyclo(Ala-Phe)?

The CAS number of Cyclo(Ala-Phe) is 14474-78-3.

What is the molecular formula of Cyclo(Ala-Phe)?

The molecular formula of Cyclo(Ala-Phe) is C12H14N2O2.

What is the molecular weight of Cyclo(Ala-Phe)?

The molecular weight of Cyclo(Ala-Phe) is 218.25.

How many carbon atoms are present in the structure of Cyclo(Ala-Phe)?

Cyclo(Ala-Phe) contains 12 carbon atoms.

What type of bond is present between Ala and Phe in Cyclo(Ala-Phe)?

A cyclic bond is present between Ala and Phe in Cyclo(Ala-Phe).

What is the stereochemistry of Cyclo(Ala-Phe)?

The stereochemistry of Cyclo(Ala-Phe) is cis.

Can Cyclo(Ala-Phe) be used as a drug or medication?

It is possible that Cyclo(Ala-Phe) could have potential therapeutic applications, but further research would be needed to determine its specific uses as a drug or medication.

※ Please kindly note that our products are for research use only.