Cyclo(Ala-Tyr)

Catalog Number	ACM21754267
CAS Number	21754-26-7
Synonyms	Cyclo-(l-alanyl-tyrosyl)
IUPAC Name	3-[(4-Hydroxyphenyl)methyl]-6-methylpiperazine-2,5-dione
Molecular Weight	234.25
Molecular Formula	C12H14N2O3
Canonical SMILES	CC1C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O
InChI	InChI=1S/C12H14N2O3/c1-7-11(16)14-10(12(17)13-7)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6H2,1H3,(H,13,17)(H,14,16)
InChI Key	MFUNIDMQFPXVGU-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	311
Exact Mass	234.10044231
Heavy Atom Count	17
Monoisotopic Mass	234.10044231
Topological Polar Surface Area	78.4Ų

Custom Q&A

What is the product name of Cyclo(Ala-Tyr)?

The product name of Cyclo(Ala-Tyr) is Cyclo(Ala-Tyr).

What are the synonyms for Cyclo(Ala-Tyr)?

The synonyms for Cyclo(Ala-Tyr) are cyclo(Tyr-Ala) and 2,5-Piperazinedione, 3-[(4-hydroxyphenyl)methyl]-6-methyl-, (3S,6S)-.

What is the CAS number of Cyclo(Ala-Tyr)?

The CAS number of Cyclo(Ala-Tyr) is 21754-26-7.

What is the molecular formula of Cyclo(Ala-Tyr)?

The molecular formula of Cyclo(Ala-Tyr) is C12H14N2O3.

What is the molecular weight of Cyclo(Ala-Tyr)?

The molecular weight of Cyclo(Ala-Tyr) is 234.25.

What is the boiling point of Cyclo(Ala-Tyr)?

The predicted boiling point of Cyclo(Ala-Tyr) is 599.6±40.0 °C.

What is the density of Cyclo(Ala-Tyr)?

The predicted density of Cyclo(Ala-Tyr) is 1.244±0.06 g/cm3.

What is the pka value of Cyclo(Ala-Tyr)?

The predicted pka value of Cyclo(Ala-Tyr) is 9.90±0.15.

How many nitrogen atoms are present in the molecular formula of Cyclo(Ala-Tyr)?

There are 2 nitrogen atoms present in the molecular formula of Cyclo(Ala-Tyr).

What functional groups are present in the structure of Cyclo(Ala-Tyr)?

Cyclo(Ala-Tyr) contains an amide group and an aromatic ring structure in its chemical composition.

※ Please kindly note that our products are for research use only.