Cyclo(D-Val-L-Pro)

Catalog Number	ACM27483187-1
CAS Number	27483-18-7
Structure
Synonyms	(3R,8aS)-Octahydro-3-(1-methylethyl)pyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	196.25
InChI	InChI=1S/C10H16N2O2/c1-6(2)8-10(14)12-5-3-4-7(12)9(13)11-8/h6-8H,3-5H2,1-2H3,(H,11,13)/t7-,8+/m0/s1
InChI Key	XLUAWXQORJEMBD-JGVFFNPUSA-N
Melting Point	153-155 °C
Purity	95%+
Complexity	275
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	196.121177757
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)[C@@H]1C(=O)N2CCC[C@H]2C(=O)N1
Monoisotopic Mass	196.121177757
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical name of Cyclo(D-Val-L-Pro)?

The chemical name of Cyclo(D-Val-L-Pro) is (3R,8aS)-Octahydro-3-(1-methylethyl)pyrrolo[1,2-a]pyrazine-1,4-dione.

What are the synonyms of Cyclo(D-Val-L-Pro)?

The synonyms of Cyclo(D-Val-L-Pro) include Cyclo(L-prolyl-D-valine), Cyclo(L-prolyl-D-valyl), and Cyclo-(S-Pro-R-Val).

What is the CAS number of Cyclo(D-Val-L-Pro)?

The CAS number of Cyclo(D-Val-L-Pro) is 27483-18-7.

What is the molecular formula of Cyclo(D-Val-L-Pro)?

The molecular formula of Cyclo(D-Val-L-Pro) is C10H16N2O2.

What is the molecular weight of Cyclo(D-Val-L-Pro)?

The molecular weight of Cyclo(D-Val-L-Pro) is 196.25.

What is the melting point of Cyclo(D-Val-L-Pro)?

The melting point of Cyclo(D-Val-L-Pro) is 153-155℃.

What is the structure of Cyclo(D-Val-L-Pro)?

The structure of Cyclo(D-Val-L-Pro) is octahydro-3-(1-methylethyl)pyrrolo[1,2-a]pyrazine-1,4-dione.

What is the diketopiperazine present in Cyclo(D-Val-L-Pro)?

The diketopiperazine present in Cyclo(D-Val-L-Pro) is D-Valyl-L-proline.

What is the chemical classification of Cyclo(D-Val-L-Pro)?

Cyclo(D-Val-L-Pro) is a pyrrolo[1,2-a]pyrazine-1,4-dione compound.

※ Please kindly note that our products are for research use only.