Cyclo(Hpro-Leu)

Catalog Number	ACM1016899936
CAS Number	1016899-93-6
IUPAC Name	7-Hydroxy-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	226.27
Molecular Formula	C11H18N2O3
Canonical SMILES	CC(C)CC1C(=O)N2CC(CC2C(=O)N1)O
InChI	InChI=1S/C11H18N2O3/c1-6(2)3-8-11(16)13-5-7(14)4-9(13)10(15)12-8/h6-9,14H,3-5H2,1-2H3,(H,12,15)
InChI Key	YEHIUWVXPQQDMC-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	316
Exact Mass	226.13174244
Heavy Atom Count	16
Monoisotopic Mass	226.13174244
Topological Polar Surface Area	69.6Ų

Custom Q&A

What is the chemical name of Cyclo(Hpro-Leu)?

The chemical name of Cyclo(Hpro-Leu) is Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-7-hydroxy-3-(2-methylpropyl)-.

What is the CAS number of Cyclo(Hpro-Leu)?

The CAS number of Cyclo(Hpro-Leu) is 1016899-93-6.

What is the molecular formula of Cyclo(Hpro-Leu)?

The molecular formula of Cyclo(Hpro-Leu) is C11H18N2O3.

What is the molecular weight of Cyclo(Hpro-Leu)?

The molecular weight of Cyclo(Hpro-Leu) is 226.27.

What is the predicted boiling point of Cyclo(Hpro-Leu?

The predicted boiling point of Cyclo(Hpro-Leu) is 486.9±45.0 °C.

What is the predicted density of Cyclo(Hpro-Leu?

The predicted density of Cyclo(Hpro-Leu) is 1.24±0.1 g/cm3.

What is the predicted pKa value of Cyclo(Hpro-Leu?

The predicted pKa value of Cyclo(Hpro-Leu) is 12.92±0.60.

What is the predicted pKa value used for in chemical reactions?

The predicted pKa value is used to determine the acidity or basicity of a molecule in chemical reactions.

How is Cyclo(Hpro-Leu) expected to behave in solution based on its chemical properties?

Based on its predicted properties, Cyclo(Hpro-Leu) is expected to have a high boiling point and low solubility in water.

How can the chemical properties of Cyclo(Hpro-Leu) impact its potential uses in various industries?

The chemical properties of Cyclo(Hpro-Leu), such as its molecular weight and predicted pKa, can influence its suitability for use in pharmaceuticals, research, or other applications where specific properties are desired.

※ Please kindly note that our products are for research use only.