Cyclo(Ile-Ala)

Catalog Number	ACM90821991-1
CAS Number	90821-99-1
IUPAC Name	3-Butan-2-yl-6-methylpiperazine-2,5-dione
Molecular Weight	184.24
Molecular Formula	C9H16N2O2
Canonical SMILES	CCC(C)C1C(=O)NC(C(=O)N1)C
InChI	InChI=1S/C9H16N2O2/c1-4-5(2)7-9(13)10-6(3)8(12)11-7/h5-7H,4H2,1-3H3,(H,10,13)(H,11,12)
InChI Key	JDRIJDPCYNFZIT-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	228
Exact Mass	184.121177757
Heavy Atom Count	13
Monoisotopic Mass	184.121177757
Topological Polar Surface Area	58.2Ų

Custom Q&A

What is the chemical formula of Cyclo(Ile-Ala)?

The chemical formula of Cyclo(Ile-Ala) is C9H16N2O2.

What is the molecular weight of Cyclo(Ile-Ala)?

The molecular weight of Cyclo(Ile-Ala) is 184.24 g/mol.

What is the CAS number of Cyclo(Ile-Ala)?

The CAS number of Cyclo(Ile-Ala) is 90821-99-1.

What are some synonyms for Cyclo(Ile-Ala)?

Some synonyms for Cyclo(Ile-Ala) are cyclo(Ala-Ile) and Cyclo(Ile Ala) Inhibitor.

What is the boiling point of Cyclo(Ile-Ala)?

The predicted boiling point of Cyclo(Ile-Ala) is 432.0±38.0 °C.

What is the predicted density of Cyclo(Ile-Ala)?

The predicted density of Cyclo(Ile-Ala) is 1.022±0.06 g/cm3.

What is the predicted pka of Cyclo(Ile-Ala)?

The predicted pka of Cyclo(Ile-Ala) is 13.27±0.60.

How does Cyclo(Ile-Ala) inhibit?

Cyclo(Ile-Ala) is an inhibitor.

What is the chemical structure of Cyclo(Ile-Ala)?

The chemical structure of Cyclo(Ile-Ala) is 3-(sec-butyl)-6-methylpiperazine-2,5-dione.

※ Please kindly note that our products are for research use only.