Cyclo(Ile-Leu)

Catalog Number	ACM91741172
CAS Number	91741-17-2
Synonyms	Cyclo-(Leu-Ile)
IUPAC Name	3-Butan-2-yl-6-(2-methylpropyl)piperazine-2,5-dione
Molecular Weight	226.32
Molecular Formula	C12H22N2O2
Canonical SMILES	CCC(C)C1C(=O)NC(C(=O)N1)CC(C)C
InChI	InChI=1S/C12H22N2O2/c1-5-8(4)10-12(16)13-9(6-7(2)3)11(15)14-10/h7-10H,5-6H2,1-4H3,(H,13,16)(H,14,15)
InChI Key	CCMDAWLYCNFDFN-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	276
Exact Mass	226.168127949
Heavy Atom Count	16
Monoisotopic Mass	226.168127949
Topological Polar Surface Area	58.2Ų

Custom Q&A

What is the chemical name of Cyclo(Ile-Leu)?

The chemical name of Cyclo(Ile-Leu) is 2,5-Piperazinedione, 3-(1-methylpropyl)-6-(2-methylpropyl)-.

What are some synonyms for Cyclo(Ile-Leu)?

Some synonyms for Cyclo(Ile-Leu) are Cyclo(Ile-Leu), 3-(sec-butyl)-6-isobutylpiperazine-2,5-dione, DL-isoleucyl-leucyl anhydride, and Cyclo(Leu-Ile).

What is the CAS number for Cyclo(Ile-Leu)?

The CAS number for Cyclo(Ile-Leu) is 91741-17-2.

What is the molecular formula of Cyclo(Ile-Leu)?

The molecular formula of Cyclo(Ile-Leu) is C12H22N2O2.

What is the molecular weight of Cyclo(Ile-Leu)?

The molecular weight of Cyclo(Ile-Leu) is 226.32 g/mol.

What is the boiling point of Cyclo(Ile-Leu)?

The predicted boiling point of Cyclo(Ile-Leu) is 444.9±38.0 °C.

What is the predicted density of Cyclo(Ile-Leu)?

The predicted density of Cyclo(Ile-Leu) is 0.979±0.06 g/cm3.

What is the predicted pka value of Cyclo(Ile-Leu)?

The predicted pka value of Cyclo(Ile-Leu) is 13.27±0.60.

※ Please kindly note that our products are for research use only.