Cyclo(L-Ala-L-Pro)

Catalog Number	ACM36357321
CAS Number	36357-32-1
Structure
Synonyms	(3S,8aS)-Hexahydro-3-methylpyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	168.19
InChI	InChI=1S/C8H12N2O2/c1-5-8(12)10-4-2-3-6(10)7(11)9-5/h5-6H,2-4H2,1H3,(H,9,11)/t5-,6-/m0/s1
InChI Key	WSLYCILIEOFQPK-WDSKDSINSA-N
Melting Point	178-181 °C
Purity	95%+
Complexity	239
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	168.08987763
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1C(=O)N2CCC[C@H]2C(=O)N1
Monoisotopic Mass	168.08987763
PhysicalState	Oil
Rotatable Bond Count	0
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical name of Cyclo(L-Ala-L-Pro)?

The chemical name of Cyclo(L-Ala-L-Pro) is Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-methyl-, (3S,8aS)- (9CI).

What are some synonyms of Cyclo(L-Ala-L-Pro)?

Some synonyms of Cyclo(L-Ala-L-Pro) include Cyclo(L-Ala-L-Pro), (3S,8aS)-Hexahydro-3-methylpyrrolo[1,2-a]pyrazine-1,4-dione, and Cyclo-(L-alanine-L-proline).

What is the CAS number of Cyclo(L-Ala-L-Pro)?

The CAS number of Cyclo(L-Ala-L-Pro) is 36357-32-1.

What is the molecular formula of Cyclo(L-Ala-L-Pro)?

The molecular formula of Cyclo(L-Ala-L-Pro) is C8H12N2O2.

What is the molecular weight of Cyclo(L-Ala-L-Pro)?

The molecular weight of Cyclo(L-Ala-L-Pro) is 168.19.

What is the melting point of Cyclo(L-Ala-L-Pro)?

The melting point of Cyclo(L-Ala-L-Pro) is in the range of 178-181℃ (methanol).

What is the boiling point of Cyclo(L-Ala-L-Pro)?

The boiling point of Cyclo(L-Ala-L-Pro) is predicted to be 426.2±34.0 °C.

What is the density of Cyclo(L-Ala-L-Pro)?

The density of Cyclo(L-Ala-L-Pro) is predicted to be 1.26±0.1 g/cm3.

What is the pka value of Cyclo(L-Ala-L-Pro)?

The pka value of Cyclo(L-Ala-L-Pro) is predicted to be 13.27±0.40.

How is Cyclo(L-Ala-L-Pro) defined in ChEBI?

In ChEBI, Cyclo(L-Ala-L-Pro) is defined as Cis-Cyclo[L-Ala-L-Pro], which is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid.

※ Please kindly note that our products are for research use only.