Cyclo(L-Leu-trans-4-hydroxy-L-Pro)

Catalog Number	ACM115006865
CAS Number	115006-86-5
Structure
Synonyms	3-Isobutyl-8-hydroxyhexahydropyrrolo [1,2-a] pyrazine-1,4-dione
Molecular Weight	226.27
InChI	InChI=1S/C11H18N2O3/c1-6(2)3-8-11(16)13-5-7(14)4-9(13)10(15)12-8/h6-9,14H,3-5H2,1-2H3,(H,12,15)/t7-,8+,9+/m1/s1
InChI Key	YEHIUWVXPQQDMC-VGMNWLOBSA-N
Purity	95%+
Complexity	316
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	226.13174244
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(C)C[C@H]1C(=O)N2C[C@@H](C[C@H]2C(=O)N1)O
Monoisotopic Mass	226.13174244
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	69.6 Ų

Custom Q&A

What is the molecular formula of Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The molecular formula is C11H18N2O3.

What is the molecular weight of Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The molecular weight is 226.27 g/mol.

What is the CAS number for Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The CAS number is 115006-86-5.

What are some synonyms for Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

Some synonyms include Cyclo(L-leucyl-trans-4-hydroxy-L-proline and 3-Isobutyl-8-hydroxyhexahydropyrrolo [1,2-a] pyrazine-1,4-dione.

What is the predicted boiling point of Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The predicted boiling point is 486.9±45.0 °C.

What is the predicted density of Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The predicted density is 1.24±0.1 g/cm3.

What is the predicted pka value of Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The predicted pka is 12.92±0.60.

What is the stereochemistry of Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

The stereochemistry is specified as (3S,7R,8aS).

How many carbon atoms are present in Cyclo(L-Leu-trans-4-hydroxy-L-Pro)?

There are 11 carbon atoms in the compound.

※ Please kindly note that our products are for research use only.