Cyclo(L-Phe-trans-4-hydroxy-L-Pro)

Catalog Number	ACM118477068
CAS Number	118477-06-8
Synonyms	(3S,7R,8aS)-3-Benzyl-7-hydroxyhexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	260.29
InChI	InChI=1S/C14H16N2O3/c17-10-7-12-13(18)15-11(14(19)16(12)8-10)6-9-4-2-1-3-5-9/h1-5,10-12,17H,6-8H2,(H,15,18)/t10-,11+,12+/m1/s1
InChI Key	PYQJYHACQOBZLF-WOPDTQHZSA-N
Purity	95%+
Complexity	379
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	260.11609238
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	C1[C@H](CN2[C@@H]1C(=O)N[C@H](C2=O)CC3=CC=CC=C3)O
Monoisotopic Mass	260.11609238
PhysicalState	Oil
Rotatable Bond Count	2
Topological Polar Surface Area	69.6 Ų

Custom Q&A

What is the chemical name of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The chemical name of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is Cyclo(L-phenylalanyl-trans-4-hydroxy-L-proline).

What are some synonyms for Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

Some synonyms for Cyclo(L-Phe-trans-4-hydroxy-L-Pro) are Cyclo(L-Phe-trans-4-hydroxy-L-Pro) and (3S,7R,8aS)-3-benzyl-7-hydroxyhexahydropyrrolo[1,2-a]pyrazine-1,4-dione.

What is the CAS number for Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The CAS number for Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is 118477-06-8.

What is the molecular formula of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The molecular formula of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is C14H16N2O3.

What is the molecular weight of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The molecular weight of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is 260.29.

What is the predicted boiling point of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The predicted boiling point of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is 568.2±50.0 °C.

What is the predicted density of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The predicted density of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is 1.35±0.1 g/cm3.

What is the predicted pKa value of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The predicted pKa value of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is 12.86±0.60.

What is the structure of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The structure of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) is (3S,7R,8aS)-3-benzyl-7-hydroxyhexahydropyrrolo[1,2-a]pyrazine-1,4-dione.

How many hydrogen atoms are present in the molecular formula of Cyclo(L-Phe-trans-4-hydroxy-L-Pro)?

The molecular formula of Cyclo(L-Phe-trans-4-hydroxy-L-Pro) contains 16 hydrogen atoms.

※ Please kindly note that our products are for research use only.