Cyclo(L-Pro-L-Ile)

Catalog Number	ACM57089608
CAS Number	57089-60-8
Synonyms	Cyclo(isoleucyl-prolyl)
IUPAC Name	(3S,8aS)-3-[(2S)-Butan-2-yl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	210.27
Molecular Formula	C11H18N2O2
Canonical SMILES	CCC(C)C1C(=O)N2CCCC2C(=O)N1
InChI	InChI=1S/C11H18N2O2/c1-3-7(2)9-11(15)13-6-4-5-8(13)10(14)12-9/h7-9H,3-6H2,1-2H3,(H,12,14)/t7-,8-,9-/m0/s1
InChI Key	ZDACRNZBFJOLTC-CIUDSAMLSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	290
Exact Mass	210.136827821
Heavy Atom Count	15
Isomeric SMILES	CC[C@H](C)[C@H]1C(=O)N2CCC[C@H]2C(=O)N1
Monoisotopic Mass	210.136827821
Topological Polar Surface Area	49.4Ų

Custom Q&A

What is the chemical name of Cyclo(L-Pro-L-Ile)?

The chemical name of Cyclo(L-Pro-L-Ile) is (3R,8aS)-3-(butan-2-yl)-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.

What are some synonyms of Cyclo(L-Pro-L-Ile)?

Some synonyms of Cyclo(L-Pro-L-Ile) are Cyclo(Ile-Pro), Cyclo (isoleucyl-prolyl), Cyclo(L-Pro-L-Ile), Cyclo(-L-Ile-L-Pro), [13C5,15N]-Cyclo(isoleucyl-prolyl), Cyclo(IP).

What is the CAS number of Cyclo(L-Pro-L-Ile)?

The CAS number of Cyclo(L-Pro-L-Ile) is 57089-60-8.

What is the molecular formula of Cyclo(L-Pro-L-Ile)?

The molecular formula of Cyclo(L-Pro-L-Ile) is C11H18N2O2.

What is the molecular weight of Cyclo(L-Pro-L-Ile)?

The molecular weight of Cyclo(L-Pro-L-Ile) is 210.27.

What is the melting point of Cyclo(L-Pro-L-Ile)?

The melting point of Cyclo(L-Pro-L-Ile) is 136 °C.

What is the predicted boiling point of Cyclo(L-Pro-L-Ile)?

The predicted boiling point of Cyclo(L-Pro-L-Ile) is 427.2±34.0 °C.

What is the predicted density of Cyclo(L-Pro-L-Ile)?

The predicted density of Cyclo(L-Pro-L-Ile) is 1.14±0.1 g/cm3.

What is the predicted pka of Cyclo(L-Pro-L-Ile)?

The predicted pka of Cyclo(L-Pro-L-Ile) is 13.27±0.40.

※ Please kindly note that our products are for research use only.