Cyclo(Leu-Ala)

Catalog Number	ACM1803607-1
CAS Number	1803-60-7
Synonyms	3-Isobutyl-6-methyl-2,5-piperazinedione
IUPAC Name	3-Methyl-6-(2-methylpropyl)piperazine-2,5-dione
Molecular Weight	184.24
Molecular Formula	C9H16N2O2
Canonical SMILES	CC1C(=O)NC(C(=O)N1)CC(C)C
InChI	InChI=1S/C9H16N2O2/c1-5(2)4-7-9(13)10-6(3)8(12)11-7/h5-7H,4H2,1-3H3,(H,10,13)(H,11,12)
InChI Key	DBJPZCJQDRPOME-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	226
Exact Mass	184.121177757
Heavy Atom Count	13
Monoisotopic Mass	184.121177757
Topological Polar Surface Area	58.2Ų

Custom Q&A

What is the chemical name of the compound with the synonym Cyclo(Leu-Ala)?

The chemical name is 3-ISOBUTYL-6-METHYL-2,5-PIPERAZINEDIONE.

What is the molecular formula of Cyclo(Leu-Ala)?

The molecular formula is C9H16N2O2.

What is the molecular weight of Cyclo(Leu-Ala)?

The molecular weight is 184.24 g/mol.

What is the storage temperature recommended for 3-ISOBUTYL-6-METHYL-2,5-PIPERAZINEDIONE?

The storage temperature recommended is 2-8°C.

What is the CAS number of Cyclo(Leu-Ala)?

The CAS number is 1803-60-7.

What is the chemical structure of Cyclo(Leu-Ala)?

It is a cyclic compound with the structure Cyclo(Leu-Ala).

In which country is the compound classified as WGK 3?

The compound is classified as WGK 3 in Germany.

What are the synonyms of 3-ISOBUTYL-6-METHYL-2,5-PIPERAZINEDIONE?

One of the synonyms is cyclo(Ala-Leu).

※ Please kindly note that our products are for research use only.