Cyclo(Ser-Pro)

Catalog Number	ACM1355217252
CAS Number	1355217-25-2
IUPAC Name	3-(Hydroxymethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Molecular Weight	184.20
Molecular Formula	C8H12N2O3
Canonical SMILES	C1CC2C(=O)NC(C(=O)N2C1)CO
InChI	InChI=1S/C8H12N2O3/c11-4-5-8(13)10-3-1-2-6(10)7(12)9-5/h5-6,11H,1-4H2,(H,9,12)
InChI Key	AHTDIKDEEMDJGD-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	254
Exact Mass	184.08479225
Heavy Atom Count	13
Monoisotopic Mass	184.08479225
Topological Polar Surface Area	69.6Ų

Custom Q&A

What is the product name of Cyclo(Ser-Pro)?

The product name of Cyclo(Ser-Pro) is Cyclo(Ser-Pro).

What are the synonyms for Cyclo(Ser-Pro)?

The synonyms for Cyclo(Ser-Pro) are Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(hydroxymethyl)-, (3R,8aR)-.

What is the CAS number of Cyclo(Ser-Pro)?

The CAS number of Cyclo(Ser-Pro) is 1355217-25-2.

What is the molecular formula of Cyclo(Ser-Pro)?

The molecular formula of Cyclo(Ser-Pro) is C8H12N2O3.

What is the molecular weight of Cyclo(Ser-Pro)?

The molecular weight of Cyclo(Ser-Pro) is 184.19.

What is the boiling point of Cyclo(Ser-Pro)?

The boiling point of Cyclo(Ser-Pro) is predicted to be 516.9±43.0 °C.

What is the density of Cyclo(Ser-Pro)?

The density of Cyclo(Ser-Pro) is predicted to be 1.40±0.1 g/cm3.

What is the predicted pKa of Cyclo(Ser-Pro)?

The predicted pKa of Cyclo(Ser-Pro) is 12.55±0.40.

What is the chemical structure of Cyclo(Ser-Pro)?

The chemical structure of Cyclo(Ser-Pro) is Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(hydroxymethyl)-, (3R,8aR)-.

※ Please kindly note that our products are for research use only.