Cyclo(Tyr-Leu)

Catalog Number	ACM82863658
CAS Number	82863-65-8
IUPAC Name	3-[(4-Hydroxyphenyl)methyl]-6-(2-methylpropyl)piperazine-2,5-dione
Molecular Weight	276.33
Molecular Formula	C15H20N2O3
Canonical SMILES	CC(C)CC1C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O
InChI	InChI=1S/C15H20N2O3/c1-9(2)7-12-14(19)17-13(15(20)16-12)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8H2,1-2H3,(H,16,20)(H,17,19)
InChI Key	GENSLUDVKWKQMX-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	362
Exact Mass	276.14739250
Heavy Atom Count	20
Monoisotopic Mass	276.14739250
Topological Polar Surface Area	78.4Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 82863-65-8?

The product name of the chemical compound with CAS number 82863-65-8 is Cyclo(Tyr-Leu).

What are some synonyms for Cyclo(Tyr-Leu)?

Some synonyms for Cyclo(Tyr-Leu) include Cyclo(L-Tyr-L-Leu), cyclo(Leu-Tyr), and 3-[(4-Hydroxyphenyl)methyl]-6-(2-methylpropyl)-2,5-piperazinedione.

What is the molecular formula of Cyclo(Tyr-Leu)?

The molecular formula of Cyclo(Tyr-Leu) is C15H20N2O3.

What is the molecular weight of Cyclo(Tyr-Leu)?

The molecular weight of Cyclo(Tyr-Leu) is 276.33.

What is the boiling point of Cyclo(Tyr-Leu)?

The boiling point of Cyclo(Tyr-Leu) is predicted to be 585.6±40.0 °C.

What is the density of Cyclo(Tyr-Leu)?

The density of Cyclo(Tyr-Leu) is predicted to be 1.155±0.06 g/cm3.

What is the pka value of Cyclo(Tyr-Leu)?

The pka value of Cyclo(Tyr-Leu) is predicted to be 9.90±0.15.

What is the CAS number of Cyclo(Tyr-Leu)?

The CAS number of Cyclo(Tyr-Leu) is 82863-65-8.

Are there any inhibitors associated with Cyclo(Tyr-Leu)?

Yes, Cyclo(Tyr-Leu) is known to be an inhibitor.

What is the chemical structure of Cyclo(Tyr-Leu)?

The chemical structure of Cyclo(Tyr-Leu) is a cyclic compound containing Tyrosine and Leucine amino acids.

※ Please kindly note that our products are for research use only.