Cyclobuxine

Catalog Number	ACM2241909
CAS Number	2241-90-9
Structure
Synonyms	(3beta,5alpha,16alpha,20S)-14-Methyl-3,20-bis(methylamino)-4-methylene-9,19-cyclopregnan-16-ol
Molecular Weight	386.6
InChI	InChI=1S/C25H42N2O/c1-15-17-7-8-20-23(4)13-19(28)21(16(2)26-5)22(23,3)11-12-25(20)14-24(17,25)10-9-18(15)27-6/h16-21,26-28H,1,7-14H2,2-6H3/t16-,17-,18-,19+,20-,21-,22+,23-,24+,25-/m0/s1
InChI Key	BSNZFQANPMIOIU-WZBMPAQFSA-N
Melting Point	236-238 °C
Purity	90%+
Complexity	692
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	10
Exact Mass	386.329713967
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5=C)NC)C)C)O)NC
Monoisotopic Mass	386.329713967
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	44.3 Ų

Custom Q&A

What is the CAS number for Cyclobuxine?

The CAS number for Cyclobuxine is 2241-90-9.

What are the synonyms for Cyclobuxine?

The synonyms for Cyclobuxine include NSC-102244, NSC 91720, and (3beta,5alpha,16alpha,20S)-14-Methyl-3,20-bis(methylamino)-4-methylene-9,19-cyclopregnan-16-ol.

What is the molecular formula of Cyclobuxine?

The molecular formula of Cyclobuxine is C25H42N2O.

What is the melting point of Cyclobuxine?

The melting point of Cyclobuxine is 236-238℃.

What is the boiling point of Cyclobuxine?

The boiling point of Cyclobuxine is 494.2±40.0℃ (760 Torr).

What is the density of Cyclobuxine at 20 ºC and 760 Torr?

The density of Cyclobuxine is 1.08±0.1 g/cm3 at 20 ºC and 760 Torr.

What is the alpha value of Cyclobuxine in chloroform?

The alpha value of Cyclobuxine in chloroform is +98° (D23).

What is the pKa value of Cyclobuxine?

The pKa value of Cyclobuxine is 15.11±0.70 (Predicted).

What is the molecular weight of Cyclobuxine?

The molecular weight of Cyclobuxine is 386.61378.

What is the usage and synthesis of Cyclobuxine?

Cyclobuxine D is a steroid alkaloid according to ChEBI.

※ Please kindly note that our products are for research use only.