Cyclovirobuxine D

Catalog Number	ACM860797-1
CAS Number	860-79-7
Structure
Synonyms	Cyclovirobuxine
IUPAC Name	(1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-Tetramethyl-6-(methylamino)-15-[(1S)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol
Molecular Weight	402.66
Molecular Formula	C26H46N2O
Canonical SMILES	CC(C1C(CC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)NC)C)C)O)NC
InChI	InChI=1S/C26H46N2O/c1-16(27-6)21-17(29)14-24(5)19-9-8-18-22(2,3)20(28-7)10-11-25(18)15-26(19,25)13-12-23(21,24)4/h16-21,27-29H,8-15H2,1-7H3/t16-,17+,18-,19-,20-,21-,23+,24-,25+,26-/m0/s1
InChI Key	GMNAPBAUIVITMI-ABNIRSKTSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	692
Exact Mass	402.361014095
Heavy Atom Count	29
Isomeric SMILES	C[C@@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)NC)C)C)O)NC
Monoisotopic Mass	402.361014095
Topological Polar Surface Area	44.3Ų

Custom Q&A

What is the chemical name of Cyclovirobuxin D?

9,19-CYCLOPREGNANE-3,20-DIAMINE,N,N',4,4,14-PENTAMETHYL-, (3,5,20S)-

What is the molecular formula of Cyclovirobuxin D?

C26H46N2O

What is the melting point of Cyclovirobuxin D?

220-221 °C (decomp)

What is the solubility of Cyclovirobuxin D in Ethanol?

Soluble to 20 mg/mL

What is the specific rotation of Cyclovirobuxin D?

[α]23D + 98° (c 4.40, CHC13)

In which plant is Cyclovirobuxin D found?

Buxus microphylla Sieb. et Zucco var. suffruticosa

What is the main indication for the use of Cyclovirobuxin D?

Treatment of cardiovascular and cerebrovascular diseases

What effect does Cyclovirobuxin D have on cardiomyocyte membrane Na+-K+-ATPase activity?

Inhibition

How does Cyclovirobuxin D protect against myocardial ischemia?

By reducing myocardial oxygen consumption and increasing coronary blood flow

Can Cyclovirobuxin D cross the blood-brain barrier?

Yes, it can.

※ Please kindly note that our products are for research use only.