Cynoglossamine

Catalog Number	ACM120193397
CAS Number	120193-39-7
Synonyms	Butanoic acid, 2-hydroxy-2-[1-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]ethyl]-3-methyl-, [(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methyl ester, (2S,3S)- (9CI)
Molecular Weight	445.5
InChI	InChI=1S/C24H31NO7/c1-15(2)24(30,16(3)32-21(28)9-6-17-4-7-19(26)8-5-17)23(29)31-14-18-10-12-25-13-11-20(27)22(18)25/h4-10,15-16,20,22,26-27,30H,11-14H2,1-3H3/b9-6+/t16,20-,22+,24-/m0/s1
InChI Key	XNECEVNOSPHNLL-HXJRXXGRSA-N
Purity	95%+
Complexity	741
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	445.21005233
Heavy Atom Count	32
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	3
Isomeric SMILES	CC(C)[C@](C(C)OC(=O)/C=C/C1=CC=C(C=C1)O)(C(=O)OCC2=CCN3[C@H]2[C@H](CC3)O)O
Monoisotopic Mass	445.21005233
PhysicalState	Powder
Rotatable Bond Count	10
Topological Polar Surface Area	117 Ų

Custom Q&A

What is the chemical formula of Cynoglossamine?

The chemical formula of Cynoglossamine is C24H31NO7.

What is the molecular weight of Cynoglossamine?

The molecular weight of Cynoglossamine is 445.51.

What is the CAS number of Cynoglossamine?

The CAS number of Cynoglossamine is 120193-39-7.

What are some synonyms for Cynoglossamine?

Some synonyms for Cynoglossamine are Butanoic acid and [(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl]methyl ester.

What are the predicted boiling point and density of Cynoglossamine?

The predicted boiling point of Cynoglossamine is 640.4±55.0 °C, and the predicted density is 1.31±0.1 g/cm3.

What is the predicted pka value of Cynoglossamine?

The predicted pka value of Cynoglossamine is 8.57±0.15.

What is the predicted boiling point of Cynoglossamine?

The predicted boiling point of Cynoglossamine is 640.4±55.0 °C.

What is the predicted density of Cynoglossamine?

The predicted density of Cynoglossamine is 1.31±0.1 g/cm3.

What is the molecular formula of Cynoglossamine?

The molecular formula of Cynoglossamine is C24H31NO7.

※ Please kindly note that our products are for research use only.