Cytisine hydrochloride

Cytisine hydrochloride

Inquiry
Catalog Number ACM6047014
CAS Number 6047-01-4
Structure
Molecular Weight 226.7
InChI InChI=1S/C11H14N2O.ClH/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11;/h1-3,8-9,12H,4-7H2;1H/t8-,9+;/m0./s1
InChI Key NNYPHEBIGWBCNH-OULXEKPRSA-N
Purity 95%+
Complexity 332
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 2
Exact Mass 226.0872908
Heavy Atom Count 15
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 2
Isomeric SMILES C1[C@H]2CNC[C@@H]1C3=CC=CC(=O)N3C2.Cl
Monoisotopic Mass 226.0872908
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 32.3 Ų
Custom Q&A

What is the chemical name of cytisine hydrochloride?

The chemical name of cytisine hydrochloride is 6-Aminopyrimidin-2(1H)-one hydrochloride.

What is the molecular formula of cytisine hydrochloride?

The molecular formula of cytisine hydrochloride is C4H6ClN3O.

What is the molecular weight of cytisine hydrochloride?

The molecular weight of cytisine hydrochloride is 147.56294.

What is the CAS number of cytisine hydrochloride?

The CAS number of cytisine hydrochloride is 6047-01-4.

What is the melting point of cytisine hydrochloride?

The melting point of cytisine hydrochloride is 260 °C.

What is the EINECS number of cytisine hydrochloride?

The EINECS number of cytisine hydrochloride is 227-940-6.

Can cytisine hydrochloride be represented by the molecular formula C4H6ClN3O?

Yes, cytisine hydrochloride can be represented by the molecular formula C4H6ClN3O.

Are there any synonyms for cytisine hydrochloride?

Yes, some synonyms for cytisine hydrochloride are (1R)-1,2,3,4,5,6-Hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one monohydrochloride; and (1R,5S)-1,2,3,4,5,6-hexahydro-8H-1,5-methanopyrido[1,2-a][1,5]diazocin-8-one hydrochloride.

What is the chemical property of cytisine hydrochloride?

The chemical property of cytisine hydrochloride includes a melting point of 260 °C.

※ Please kindly note that our products are for research use only.