D-Tetrahydropalmatine

Catalog Number	ACM3520147
CAS Number	3520-14-7
Structure
Synonyms	2,3,9,10-TetraMethoxy-13aβ-berbine
Molecular Weight	355.4
InChI	InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m1/s1
InChI Key	AEQDJSLRWYMAQI-QGZVFWFLSA-N
Melting Point	138-139 °C
Purity	95%+
Complexity	475
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	355.17835828
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC1=C(C2=C(C[C@@H]3C4=CC(=C(C=C4CCN3C2)OC)OC)C=C1)OC
Monoisotopic Mass	355.17835828
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	40.2 Ų

Custom Q&A

What is the molecular formula of D-Tetrahydropalmatine?

The molecular formula of D-Tetrahydropalmatine is C21H25NO4.

What is the melting point of D-Tetrahydropalmatine?

The melting point of D-Tetrahydropalmatine is 138-139 °C.

Where can D-Tetrahydropalmatine be stored?

D-Tetrahydropalmatine can be stored in a refrigerator.

What are the solubility properties of D-Tetrahydropalmatine?

D-Tetrahydropalmatine is slightly soluble in chloroform, ethanol (sonicated), and methanol.

What is the color of D-Tetrahydropalmatine?

D-Tetrahydropalmatine is white to pale yellow in color.

From which traditional Chinese herb is D-Tetrahydropalmatine isolated?

D-Tetrahydropalmatine is isolated from a traditional Chinese herb called Rhizoma Corydalis (yanhusuo).

What neurotransmitters does D-Tetrahydropalmatine inhibit uptake of in the rat brain?

D-Tetrahydropalmatine inhibits dopamine and serotonin uptake in synaptosomes in the rat brain.

What enzymes does D-Tetrahydropalmatine show inhibitory effects on?

D-Tetrahydropalmatine shows inhibitory effects on acetylcholinesterase and butyrylcholinesterase.

What is the boiling point of D-Tetrahydropalmatine?

The predicted boiling point of D-Tetrahydropalmatine is 482.9±45.0 °C.

What is the pka value of D-Tetrahydropalmatine?

The predicted pka value of D-Tetrahydropalmatine is 6.53±0.20.

※ Please kindly note that our products are for research use only.