Dapagliflozin

Dapagliflozin

Inquiry
Catalog Number ACM461432268-1
CAS Number 461432-26-8
Structure
Synonyms Forxiga
IUPAC Name (2S,3R,4R,5S,6R)-2-[4-Chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol
Molecular Weight 408.87
Molecular Formula C21H25ClO6
Canonical SMILES CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)C3C(C(C(C(O3)CO)O)O)O)Cl
InChI InChI=1S/C21H25ClO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1
InChI Key JVHXJTBJCFBINQ-ADAARDCZSA-N
Purity 98%+
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 472
Exact Mass 408.1339662
Heavy Atom Count 28
Isomeric SMILES CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl
Monoisotopic Mass 408.1339662
Topological Polar Surface Area 99.4Ų
Custom Q&A

What is the chemical name of Dapagliflozin?

Dapagliflozin is also known as DAPAGLIFLOZIN; (1S)-1,5-Anhydro-1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucitol.

What is the molecular formula of Dapagliflozin?

The molecular formula of Dapagliflozin is C21H25ClO6.

What is the pharmacological effect of Dapagliflozin?

Dapagliflozin is a sodium-glucose co-transporter 2 inhibitor that allows extra glucose to be excreted through the urine, improving glycemic control without increasing insulin secretion.

How is Dapagliflozin metabolized in the body?

Dapagliflozin is mainly metabolized by the uridine diphosphate glucuronosyltransferase 1A9 (UGT1A9) in the liver.

How is Dapagliflozin synthesized?

Dapagliflozin is synthesized through several steps, including acylating chlorination, condensation with glucopyranosanoic acid lactone, and etherification.

What is the drug interaction profile of Dapagliflozin?

Dapagliflozin is mainly metabolized in the liver by UGT1A9 metabolism and is a P-glycoprotein substrate. It does not show significant interactions with several other drugs, but rifampicin and mefenamic acid can affect its exposure amount.

What is the safety profile of Dapagliflozin?

Dapagliflozin has excellent tolerance and safety, with the common adverse events being hypoglycemia, polyuria, back pain, and urinary tract infections.

How does Dapagliflozin compare with other hypoglycemic drugs in terms of efficacy?

Dapagliflozin's efficacy is comparable with dipeptidyl peptidase inhibitors and several new hypoglycemic drugs, and can mildly lower blood pressure and body weight.

What is the brand name under which Dapagliflozin is marketed?

Dapagliflozin is marketed under the brand name Farxiga.

※ Please kindly note that our products are for research use only.