Daphmacropodine

Catalog Number	ACM39729210
CAS Number	39729-21-0
Synonyms	(1S,2S,5S,7R,8R)-7-Hydroxy-8-{2-[(1S,2R,3S,7R,10S,13S,14R)-14-isopropyl-1-methyl-12-azapentacyclo[8.6.0.0sup2,13sup.0sup3,7sup.0sup7,12sup]hexadec-2-yl]ethyl}-1,5-dimethyl-6-oxabicyclo[3.2.1]oct-2-ylacetate
Molecular Weight	513.8
InChI	InChI=1S/C32H51NO4/c1-19(2)22-10-14-28(4)21-9-16-31-13-7-8-24(31)32(28,26(22)33(31)18-21)17-11-23-29(5)15-12-25(36-20(3)34)30(23,6)27(35)37-29/h19,21-27,35H,7-18H2,1-6H3/t21-,22-,23+,24-,25+,26+,27-,28+,29+,30+,31-,32+/m1/s1
InChI Key	QCDMEBFUPVLRNE-CDRMYCHRSA-N
Melting Point	214-215 °C
Purity	95%+
Complexity	984
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	12
Exact Mass	513.38180911
Heavy Atom Count	37
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC(C)[C@H]1CC[C@]2([C@@H]3CC[C@]45CCC[C@H]4[C@]2([C@H]1N5C3)CC[C@H]6[C@@]7(CC[C@@H]([C@]6([C@@H](O7)O)C)OC(=O)C)C)C
Monoisotopic Mass	513.38180911
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	59 Ų

Custom Q&A

What is the CAS number of Daphmacropodine?

The CAS number of Daphmacropodine is 39729-21-0.

What is the molecular formula of Daphmacropodine?

The molecular formula of Daphmacropodine is C32H51NO4.

What is the molecular weight of Daphmacropodine?

The molecular weight of Daphmacropodine is 513.76.

What is the melting point of Daphmacropodine?

The melting point of Daphmacropodine is 214-215 °C.

In what form is Daphmacropodine?

Daphmacropodine is in powder form.

What is the predicted boiling point of Daphmacropodine?

The predicted boiling point of Daphmacropodine is 573.2±40.0 °C.

In what solvents is Daphmacropodine soluble?

Daphmacropodine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted pka of Daphmacropodine?

The predicted pka of Daphmacropodine is 12.93±0.70.

What are some synonyms of Daphmacropodine?

Some synonyms of Daphmacropodine include 6-Oxabicyclo[3.2.1]octane-2,7-diol and 1,5-dimethyl-8-[2-[(3aR,4S,4aS,5R,8S,8aR,8bS,10S)-octahydro-8-methyl-5-(1-methylethyl)-4,8,3a-[1,2,4]butanetriylcyclopent[b]indol-8a(4aH)-yl]ethyl]-, 2-acetate.

※ Please kindly note that our products are for research use only.