Daphnicyclidin D

Catalog Number	ACM385384247
CAS Number	385384-24-7
Molecular Weight	381.5
InChI	InChI=1S/C23H27NO4/c1-11-9-24-10-12-4-5-15-17-13(6-7-28-15)18(22(26)27-3)19-20(17)23(12,2)16(24)8-14(11)21(19)25/h11-12,14,16H,4-10H2,1-3H3/t11-,12-,14-,16-,23-/m1/s1
InChI Key	DTNVJGYTJYNCDT-UHCAAFETSA-N
Purity	95%+
Complexity	925
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	381.19400834
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1CN2C[C@H]3CCC4=C5C(=C(C6=C5[C@]3([C@H]2C[C@H]1C6=O)C)C(=O)OC)CCO4
Monoisotopic Mass	381.19400834
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	55.8 Ų

Custom Q&A

What is the chemical formula for Daphnicyclidin D?

The chemical formula for Daphnicyclidin D is C23H27NO4.

What is the molecular weight of Daphnicyclidin D?

The molecular weight of Daphnicyclidin D is 381.47.

What is the boiling point of Daphnicyclidin D?

The boiling point of Daphnicyclidin D is predicted to be 550.4±50.0 °C.

What is the density of Daphnicyclidin D?

The density of Daphnicyclidin D is predicted to be 1.32±0.1 g/cm3.

What is the pka value of Daphnicyclidin D?

The pka value of Daphnicyclidin D is predicted to be 8.53±0.70.

How is Daphnicyclidin D commonly referred to?

Daphnicyclidin D is also known as Daphnicyclidine D.

What is the chemical name of Daphnicyclidin D?

The chemical name of Daphnicyclidin D is 1,12-Methanopyrano[4',3',2':1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, 3,4,6,7,7a,8,10,11,12,13,13a,13b-dodecahydro-11,13b-dimethyl-14-oxo-, methyl ester, (7aS,9S,11S,12R,13aR,13bS)-

What is the CAS number for Daphnicyclidin D?

The CAS number for Daphnicyclidin D is 385384-24-7.

How is the stereochemistry of Daphnicyclidin D described?

The stereochemistry of Daphnicyclidin D is described as (7aS,9S,11S,12R,13aR,13bS).

※ Please kindly note that our products are for research use only.