Daphnicyclidin F

Catalog Number	ACM385384269
CAS Number	385384-26-9
Molecular Weight	397.5
InChI	InChI=1S/C23H27NO5/c1-11-9-24-10-12-4-5-14-16-13(6-7-29-14)17(21(26)28-3)18-19(16)22(12,2)15(24)8-23(11,27)20(18)25/h11-12,15,27H,4-10H2,1-3H3/t11-,12-,15-,22-,23+/m1/s1
InChI Key	CBULSUOPAXBENF-VBIFSVJFSA-N
Purity	95%+
Complexity	974
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	397.18892296
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1CN2C[C@H]3CCC4=C5C(=C(C6=C5[C@]3([C@H]2C[C@]1(C6=O)O)C)C(=O)OC)CCO4
Monoisotopic Mass	397.18892296
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the full chemical name of Daphnicyclidin F?

1,12-Methanopyrano[2',3',4':8,1]azuleno[4,5-a]indolizine-2-carboxylic acid, 3,4,6,7,7a,8,10,11,12,13,13a,13b-dodecahydro-12-hydroxy-11,13b-dimethyl-14-oxo-, methyl ester, (7aS,9R,11R,12S,13aR,13bS)-

What is the CAS number of Daphnicyclidin F?

385384-26-9

What is the molecular formula of Daphnicyclidin F?

C23H27NO5

What is the molecular weight of Daphnicyclidin F?

397.47

What is the predicted boiling point of Daphnicyclidin F?

604.7±55.0 °C

What is the predicted density of Daphnicyclidin F?

1.39±0.1 g/cm3

What is the predicted pka value of Daphnicyclidin F?

12.27±0.70

What are some synonyms for Daphnicyclidin F?

Daphnicyclidine F

How many carbon, hydrogen, nitrogen, and oxygen atoms are present in the molecular formula of Daphnicyclidin F?

23 carbon atoms, 27 hydrogen atoms, 1 nitrogen atom, and 5 oxygen atoms

※ Please kindly note that our products are for research use only.