Daphnilongeranin A

Catalog Number	ACM874201055
CAS Number	874201-05-5
Molecular Weight	383.5
InChI	InChI=1S/C23H29NO4/c1-12-10-24-11-13-4-5-17-19-14(6-7-28-17)16(21(26)27-3)9-23(19)20(25)15(12)8-18(24)22(13,23)2/h12-13,15,18H,4-11H2,1-3H3/t12-,13-,15-,18-,22-,23+/m1/s1
InChI Key	TVYCEKHYHLUROK-DCLOCNOKSA-N
Purity	95%+
Complexity	872
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	383.20965841
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1CN2C[C@H]3CCC4=C5C(=C(C[C@]56[C@]3([C@H]2C[C@H]1C6=O)C)C(=O)OC)CCO4
Monoisotopic Mass	383.20965841
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	55.8 Ų

Custom Q&A

What is the ester present in Daphnilongeranin A?

The ester present is methyl ester.

What are some synonyms for Daphnilongeranin A?

Some synonyms for Daphnilongeranin A are 1H-12,13c-Methanopyrano[2',3',4':8,1]azuleno[4,5-a]indolizine-2-carboxylic acid, etc.

What is the molecular formula of Daphnilongeranin A?

The molecular formula is C23H29NO4.

What is the molecular weight of Daphnilongeranin A?

The molecular weight is 383.48.

In what forms is Daphnilongeranin A soluble?

Daphnilongeranin A is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the source of Daphnilongeranin A?

Daphnilongeranin A is a natural product from Cimicifuga foetida L.

What is the CAS number of Daphnilongeranin A?

The CAS number is 874201-05-5.

What is the chemical structure of Daphnilongeranin A?

The chemical structure is 1H-12,13c-Methanopyrano[2',3',4':8,1]azuleno[4,5-a]indolizine-2-carboxylic acid.

What is the physical form of Daphnilongeranin A?

It is in the form of powder.

※ Please kindly note that our products are for research use only.