Daphniyunnine A

Catalog Number	ACM881388870
CAS Number	881388-87-0
Molecular Weight	369.5
InChI	InChI=1S/C23H31NO3/c1-12-10-24-11-14-6-4-13-5-7-15-17(21(26)27-3)9-23(19(13)15)20(25)16(12)8-18(24)22(14,23)2/h12,14-18H,4-11H2,1-3H3/t12-,14-,15-,16-,17-,18-,22-,23+/m1/s1
InChI Key	UMIPHFQOKSWKPK-ZGIUMOQOSA-N
Purity	95%+
Complexity	787
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	8
Exact Mass	369.23039385
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1CN2C[C@H]3CCC4=C5[C@H](CC4)[C@@H](C[C@]56[C@]3([C@H]2C[C@H]1C6=O)C)C(=O)OC
Monoisotopic Mass	369.23039385
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	46.6 Ų

Custom Q&A

What is the chemical name of Daphniyunnine A?

The chemical name of Daphniyunnine A is 1H-11,12c-Methanocyclopent[1,8]azuleno[4,5-a]indolizine-2-carboxylic acid, 2,2a,3,4,5,6,6a,7,9,10,11,12,12a,12b-tetradecahydro-13-oxo-10,12b-dimethyl-, methyl ester.

What is the CAS number of Daphniyunnine A?

The CAS number of Daphniyunnine A is 881388-87-0.

What is the molecular formula of Daphniyunnine A?

The molecular formula of Daphniyunnine A is C23H31NO3.

What is the molecular weight of Daphniyunnine A?

The molecular weight of Daphniyunnine A is 369.5.

At what temperature does Daphniyunnine A melt?

Daphniyunnine A melts at 171-172 °C (in acetone).

In what solvents is Daphniyunnine A soluble?

Daphniyunnine A is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of Daphniyunnine A?

Daphniyunnine A is in powder form.

What is the predicted pka value of Daphniyunnine A?

The predicted pka value of Daphniyunnine A is 8.15±0.70.

Where does Daphniyunnine A come from?

Daphniyunnine A is a natural product from Daphniphyllum macropodum Miq.

What is the predicted boiling point of Daphniyunnine A?

The predicted boiling point of Daphniyunnine A is 490.3±45.0 °C.

※ Please kindly note that our products are for research use only.