Daphniyunnine b

Catalog Number	ACM881388881
CAS Number	881388-88-1
Molecular Weight	343.5
Molecular Formula	C21H29NO3
InChI	InChI=1S/C21H29NO3/c1-12-10-22-11-14-3-4-16(24)18-13(6-8-23)5-7-21(18)19(25)15(12)9-17(22)20(14,21)2/h12,14-15,17,23H,3-11H2,1-2H3/t12-,14-,15-,17-,20-,21+/m1/s1
InChI Key	XALHQXXUICHGPI-YSQOEHLKSA-N
Purity	95%+
Density	5mg 10mg 20 mg
Complexity	697
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	343.21474379
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1CN2C[C@H]3CCC(=O)C4=C(CC[C@]45[C@]3([C@H]2C[C@H]1C5=O)C)CCO
Monoisotopic Mass	343.21474379
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	57.6 Ų

Custom Q&A

What is the chemical name of Daphniyunnine B?

The chemical name of Daphniyunnine B is 4H-11,12c-Methanoazuleno[4,5-a]indolizine-4,13-dione, 1,2,5,6,6a,7,9,10,11,12,12a,12b-dodecahydro-3-(2-hydroxyethyl)-10,12b-dimethyl-, (6aS,8S,10S,11R,12aR,12bS,12cS)-.

What is the CAS number of Daphniyunnine B?

The CAS number of Daphniyunnine B is 881388-88-1.

What is the molecular formula of Daphniyunnine B?

The molecular formula of Daphniyunnine B is C21H29NO3.

What is the molecular weight of Daphniyunnine B?

The molecular weight of Daphniyunnine B is 343.46 g/mol.

What is the boiling point of Daphniyunnine B?

The boiling point of Daphniyunnine B is predicted to be 521.6±50.0 °C.

In what solvents is Daphniyunnine B soluble?

Daphniyunnine B is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the physical form of Daphniyunnine B?

Daphniyunnine B is in powder form.

What is the predicted density of Daphniyunnine B?

The predicted density of Daphniyunnine B is 1.25±0.1 g/cm3.

What is the predicted pKa value of Daphniyunnine B?

The predicted pKa value of Daphniyunnine B is 15.04±0.10.

※ Please kindly note that our products are for research use only.