Darlingine

Catalog Number	ACM58471106
CAS Number	58471-10-6
Molecular Weight	219.28
InChI	InChI=1S/C13H17NO2/c1-7-8(2)16-11-6-9-4-5-10(14(9)3)12(11)13(7)15/h9-10H,4-6H2,1-3H3
InChI Key	WBTZDCUVPGAROE-UHFFFAOYSA-N
Melting Point	162-165 °C
Purity	95%+
Complexity	433
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	219.125928785
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	219.125928785
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the product name of the compound with CAS number 58471-10-6?

The product name of the compound with CAS number 58471-10-6 is Darlingine.

What are the synonyms for Darlingine?

The synonyms for Darlingine are 5,7-Ethano-4H-pyrano[3,2-c]pyridin-4-one, 5,6,7,8-tetrahydro-2,3,6-trimethyl-, (5R,7S)-.

What is the molecular formula of Darlingine?

The molecular formula of Darlingine is C13H17NO2.

What is the molecular weight of Darlingine?

The molecular weight of Darlingine is 219.28.

What is the melting point of Darlingine?

The melting point of Darlingine is 162-5°C.

Where does darlingine occur and what type of alkaloid is it?

Darlingine occurs in Darlingea ferruginea and it is a novel tropane type alkaloid.

How does darlingine furnish and what is its specific rotation?

Darlingine furnishes colourless needles from EtOH-Et20 and has a specific rotation of [α]19D + 104° (CHCI3).

How has the structure of darlingine been determined?

The structure of darlingine has been determined by chemical degradation and from spectroscopic analysis.

What is the reference for more information on darlingine?

The reference for more information on darlingine is Bick, Gillard, Woodruff, Chern. Ind. (London), 794 (1975).

※ Please kindly note that our products are for research use only.