Dauricinoline

Catalog Number	ACM30984806
CAS Number	30984-80-6
Structure
Synonyms	(1R)-1,2,3,4-Tetrahydro-1-[[4-hydroxy-3-[4-[[(1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl]methyl]phenoxy]phenyl]methyl]-7-methoxy-2-methyl-6-isoquinolinol
Molecular Weight	610.7
InChI	InChI=1S/C37H42N2O6/c1-38-15-13-26-20-36(43-4)37(44-5)22-29(26)30(38)16-23-6-9-27(10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-34(42-3)33(41)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1
InChI Key	OMFKIOLXDGQKCF-FIRIVFDPSA-N
Purity	95%+
Complexity	917
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	610.30428706
Heavy Atom Count	45
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	2
Isomeric SMILES	CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)O)OC)O)OC)OC
Monoisotopic Mass	610.30428706
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	83.9 Ų

Custom Q&A

What is the chemical formula of Dauricinoline?

The chemical formula of Dauricinoline is C37H42N2O6.

What is the molecular weight of Dauricinoline?

The molecular weight of Dauricinoline is 610.74.

What is the boiling point of Dauricinoline?

The boiling point of Dauricinoline is predicted to be 724.5±60.0 °C.

What is the density of Dauricinoline?

The density of Dauricinoline is 1.218.

What is the pKa value of Dauricinoline?

The pKa value of Dauricinoline is predicted to be 9.31±0.45.

What is the synonym for Dauricinoline starting with (1R)?

The synonym for Dauricinoline starting with (1R) is (1R)-1,2,3,4-Tetrahydro-1-[[4-hydroxy-3-[4-[[(1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl]methyl]phenoxy]phenyl]methyl]-7-methoxy-2-methyl-6-isoquinolinol.

What is the common usage of Dauricinoline?

Dauricinoline is known to be an NF-χB inhibitor and is similar to Dauricine, inducing severe lung toxicity in animals.

What is another alkaloid similar to Dauricinoline?

Dauricine is another alkaloid similar to Dauricinoline.

What is the CAS number for Dauricinoline?

The CAS number for Dauricinoline is 30984-80-6.

What is the chemical structure of Dauricinoline?

The chemical structure of Dauricinoline is (1R)-1-[[3-[4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-4-hydroxyphenyl]methyl]-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-6-ol.

※ Please kindly note that our products are for research use only.