Dauricumine

Catalog Number	ACM345641001
CAS Number	345641-00-1
IUPAC Name	(1S,4'R,6S,10R,11S)-11-Chloro-4'-hydroxy-3',4,5-trimethoxy-7-methylspiro[7-azatricyclo[4.3.3.01,6]dodec-4-ene-10,5'-cyclopent-2-ene]-1',3-dione
Molecular Weight	397.85
Molecular Formula	C19H24CNO6
Canonical SMILES	CN1CCC23C1(CC(C24C(C(=CC4=O)OC)O)Cl)C(=C(C(=O)C3)OC)OC
InChI	InChI=1S/C19H24ClNO6/c1-21-6-5-17-8-10(22)14(26-3)16(27-4)18(17,21)9-12(20)19(17)13(23)7-11(25-2)15(19)24/h7,12,15,24H,5-6,8-9H2,1-4H3/t12-,15-,17+,18+,19+/m0/s1
InChI Key	FSXRARBVZZKCGJ-WPLONRSQSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	793
Exact Mass	397.1292152
Heavy Atom Count	27
Isomeric SMILES	CN1CC[C@@]23[C@@]1(C[C@@H]([C@@]24[C@H](C(=CC4=O)OC)O)Cl)C(=C(C(=O)C3)OC)OC
Monoisotopic Mass	397.1292152
Topological Polar Surface Area	85.3Ų

Custom Q&A

What is the chemical formula of Dauricumine?

The chemical formula of Dauricumine is C19H24ClNO6.

What is the molecular weight of Dauricumine?

The molecular weight of Dauricumine is 397.85.

What is the CAS number of Dauricumine?

The CAS number of Dauricumine is 345641-00-1.

What is the melting point of Dauricumine?

The melting point of Dauricumine is 205 °C.

What is the predicted boiling point of Dauricumine?

The predicted boiling point of Dauricumine is 667.3±55.0 °C.

What is the predicted density of Dauricumine?

The predicted density of Dauricumine is 1.41±0.1 g/cm3.

What is the predicted pka value of Dauricumine?

The predicted pka value of Dauricumine is 11.05±0.70.

What are the synonyms of Dauricumine?

The synonyms of Dauricumine include Spiro[3-cyclopentene-1,10'-[3a,7a]propano[1H]indole]-2,5'(4'H)-dione, 9'-chloro-2',3'-dihydro-5-hydroxy-4,6',7'-trimethoxy-1-methyl-, (1R,3'aS,5R,7'aS,9'S)-.

What is the full name of the compound Dauricumine?

The full name of Dauricumine is Spiro[3-cyclopentene-1,10'-[3a,7a]propano[1H]indole]-2,5'(4'H)-dione, 9'-chloro-2',3'-dihydro-5-hydroxy-4,6',7'-trimethoxy-1-methyl-, (1R,3'aS,5R,7'aS,9'S)-.

※ Please kindly note that our products are for research use only.